Source code for pyfstat.mcmc_based_searches

"""PyFstat search & follow-up classes using MCMC-based methods

The general approach is described in
Ashton & Prix (PRD 97, 103020, 2018):
https://arxiv.org/abs/1802.05450
and we use the `ptemcee` sampler
described in Vousden et al. (MNRAS 455, 1919-1937, 2016):
https://arxiv.org/abs/1501.05823
and based on Foreman-Mackey et al. (PASP 125, 306, 2013):
https://arxiv.org/abs/1202.3665

Defining the prior
##################

The MCMC based searches (i.e. `pyfstat.MCMC*`) require a prior specification for each model parameter,
implemented via a `python dictionary <https://docs.python.org/tutorial/datastructures.html#dictionaries>`_.
This is best explained through a simple example, here is the prior for a *directed* search with a *uniform*
prior on the frequency and a *normal* prior on the frequency derivative:

.. code-block:: python

    theta_prior = {'F0': {'type': 'unif',
                          'lower': 29.9,
                          'upper': 30.1},
                   'F1': {'type': 'norm',
                          'loc': 0,
                          'scale': 1e-10},
                   'F2': 0,
                   'Alpha': 2.3,
                   'Delta': 1.8
                   }

For the sky positions ``Alpha`` and ``Delta``, we give the fixed values (i.e. they are considered *known* by
the MCMC simulation), the same is true for ``F2``, the second derivative of the frequency which we fix at ``0``.
Meanwhile, for the frequency ``F0`` and first frequency derivative ``F1`` we give a dictionary specifying their
prior distribution. This dictionary must contain three arguments: the ``type`` (in this case either ``unif`` or
``norm``) which specifies the type of distribution, then two shape arguments. The shape parameters will depend
on the ``type`` of distribution, but here we use ``lower`` and ``upper``, required for the ``unif`` prior while
``loc`` and ``scale`` are required for the ``norm`` prior.

Currently, two other types of prior are implemented: ``halfnorm``, ``neghalfnorm`` (both of which require ``loc``
and ``scale`` shape parameters). Further priors can be added by modifying ``pyfstat.MCMCSearch._generic_lnprior``.

"""

import copy
import logging
import os
import sys
from collections import OrderedDict

import corner
import dill as pickle
import matplotlib
import matplotlib.pyplot as plt
import numpy as np
from ptemcee import Sampler as PTSampler
from scipy.stats import lognorm

import pyfstat.core as core
import pyfstat.helper_functions as helper_functions
import pyfstat.optimal_setup_functions as optimal_setup_functions
from pyfstat.core import BaseSearchClass, args, tqdm


[docs]class MCMCSearch(BaseSearchClass): """ MCMC search using ComputeFstat. Evaluates the coherent F-statistic across a parameter space region corresponding to an isolated/binary-modulated CW signal. """ symbol_dictionary = dict( F0=r"$f$", F1=r"$\dot{f}$", F2=r"$\ddot{f}$", Alpha=r"$\alpha$", Delta=r"$\delta$", asini=r"asini", period=r"P", ecc=r"ecc", tp=r"tp", argp=r"argp", ) """ Key, val pairs of the parameters (`F0`, `F1`, ...), to LaTeX math symbols for plots """ unit_dictionary = dict( F0=r"Hz", F1=r"Hz/s", F2=r"Hz/s$^2$", Alpha=r"rad", Delta=r"rad", asini="", period=r"s", ecc="", tp=r"s", argp="", ) """ Key, val pairs of the parameters (i.e. `F0`, `F1`), and the units (i.e. `Hz`) """ transform_dictionary = {} """ Key, val pairs of the parameters (i.e. `F0`, `F1`), where the key is itself a dictionary which can item `multiplier`, `subtractor`, or `unit` by which to transform by and update the units. """ def __init__( self, theta_prior, tref, label, outdir="data", minStartTime=None, maxStartTime=None, sftfilepattern=None, detectors=None, nsteps=[100, 100], nwalkers=100, ntemps=1, log10beta_min=-5, theta_initial=None, rhohatmax=1000, binary=False, BSGL=False, SSBprec=None, RngMedWindow=None, minCoverFreq=None, maxCoverFreq=None, injectSources=None, assumeSqrtSX=None, transientWindowType=None, tCWFstatMapVersion="lal", earth_ephem=None, sun_ephem=None, allowedMismatchFromSFTLength=None, ): """ Parameters ---------- theta_prior: dict Dictionary of priors and fixed values for the search parameters. For each parameters (key of the dict), if it is to be held fixed the value should be the constant float, if it is be searched, the value should be a dictionary of the prior. tref, minStartTime, maxStartTime: int GPS seconds of the reference time, start time and end time. While tref is requirede, minStartTime and maxStartTime default to None in which case all available data is used. label, outdir: str A label and output directory (optional, default is `data`) to name files sftfilepattern: str, optional Pattern to match SFTs using wildcards (`*?`) and ranges [0-9]; mutiple patterns can be given separated by colons. detectors: str, optional Two character reference to the detectors to use, specify None for no contraint and comma separated strings for multiple references. nsteps: list (2,), optional Number of burn-in and production steps to take, [nburn, nprod]. See `pyfstat.MCMCSearch.setup_initialisation()` for details on adding initialisation steps. nwalkers, ntemps: int, optional The number of walkers and temperates to use in the parallel tempered PTSampler. log10beta_min: float < 0, optional The log_10(beta) value. If given, the set of betas passed to PTSampler are generated from `np.logspace(0, log10beta_min, ntemps)` (given in descending order to ptemcee). theta_initial: dict, array, optional A dictionary of distribution about which to distribute the initial walkers about. rhohatmax: float, optional Upper bound for the SNR scale parameter (required to normalise the Bayes factor) - this needs to be carefully set when using the evidence. binary: bool, optional If true, search over binary orbital parameters. BSGL: bool, optional If true, use the BSGL statistic. SSBPrec: int, optional SSBPrec (SSB precision) to use when calling ComputeFstat. See `core.ComputeFstat`. RngMedWindow: int, optional Running-Median window size (number of bins) for ComputeFstat. See `core.ComputeFstat`. minCoverFreq, maxCoverFreq: float, optional Minimum and maximum instantaneous frequency which will be covered over the SFT time span as passed to CreateFstatInput. See `core.ComputeFstat`. injectSources: dict, optional If given, inject these properties into the SFT files before running the search. See `core.ComputeFstat`. assumeSqrtSX: float or list or str Don't estimate noise-floors, but assume (stationary) per-IFO sqrt{SX}. See `core.ComputeFstat`. transientWindowType: str If 'rect' or 'exp', compute atoms so that a transient (t0,tau) map can later be computed. ('none' instead of None explicitly calls the transient-window function, but with the full range, for debugging). See `core.ComputeFstat`. Currently only supported for nsegs=1. tCWFstatMapVersion: str Choose between standard 'lal' implementation, 'pycuda' for gpu, and some others for devel/debug. allowedMismatchFromSFTLength: float Maximum allowed mismatch from SFTs being too long [Default: what's hardcoded in XLALFstatMaximumSFTLength]. """ self._set_init_params_dict(locals()) self.theta_prior = theta_prior self.tref = tref self.label = label self.outdir = outdir self.minStartTime = minStartTime self.maxStartTime = maxStartTime self.sftfilepattern = sftfilepattern self.detectors = detectors self.nsteps = nsteps self.nwalkers = nwalkers self.ntemps = ntemps self.log10beta_min = log10beta_min self.theta_initial = theta_initial self.rhohatmax = rhohatmax self.binary = binary self.BSGL = BSGL self.SSBprec = SSBprec self.RngMedWindow = RngMedWindow self.minCoverFreq = minCoverFreq self.maxCoverFreq = maxCoverFreq self.injectSources = injectSources self.assumeSqrtSX = assumeSqrtSX self.transientWindowType = transientWindowType self.tCWFstatMapVersion = tCWFstatMapVersion self.set_ephemeris_files(earth_ephem, sun_ephem) self.allowedMismatchFromSFTLength = allowedMismatchFromSFTLength os.makedirs(outdir, exist_ok=True) self.output_file_header = self.get_output_file_header() self._add_log_file(self.output_file_header) logging.info("Set-up MCMC search for model {}".format(self.label)) if sftfilepattern: logging.info("Using data {}".format(self.sftfilepattern)) else: logging.info("No sftfilepattern given") if injectSources: logging.info("Inject sources: {}".format(injectSources)) self.pickle_path = os.path.join(self.outdir, self.label + "_saved_data.p") self._unpack_input_theta() self.ndim = len(self.theta_keys) if self.log10beta_min: self.betas = np.logspace(0, self.log10beta_min, self.ntemps) else: self.betas = None if args.clean and os.path.isfile(self.pickle_path): os.rename(self.pickle_path, self.pickle_path + ".old") self._set_likelihoodcoef() self._log_input() def _set_likelihoodcoef(self): """Additional constant terms to turn a detection statistic into a likelihood. In general, the (log-)likelihood can be obtained from the signal-to-noise (log-)Bayes factor (omitting the overall Gaussian-noise normalization term) but the detection statistic may only be a monotonic function of the Bayes factor, not the full thing. E.g. this is the case for the standard CW F-statistic! """ if self.BSGL: # In this case, the corresponding term is already included # in the detection statistic itself. # See Eq. (36) in Keitel et al (PRD 89, 064023, 2014): # https://arxiv.org/abs/1311.5738 # where Fstar0 = ln(cstar) = ln(rhohatmax**4/70). # We just need to switch to natural log basis. self.likelihooddetstatmultiplier = np.log(10) self.likelihoodcoef = 0 else: # If assuming only Gaussian noise + signal, # the likelihood is essentially the F-statistic, # but with an extra constant term depending on the amplitude prior. # See Eq. (9) of Ashton & Prix (PRD 97, 103020, 2018): # https://arxiv.org/abs/1802.05450 # Also need to go from twoF to F. self.likelihooddetstatmultiplier = 0.5 self.likelihoodcoef = np.log(70.0 / self.rhohatmax**4) def _log_input(self): logging.info("theta_prior = {}".format(self.theta_prior)) logging.info("nwalkers={}".format(self.nwalkers)) logging.info("nsteps = {}".format(self.nsteps)) logging.info("ntemps = {}".format(self.ntemps)) logging.info("log10beta_min = {}".format(self.log10beta_min)) def _get_search_ranges(self): """take prior widths as proxy "search ranges" to allow covering band estimate""" if (self.minCoverFreq is None) or (self.maxCoverFreq is None): normal_stds = 3 # this might not always be enough prior_bounds, norm_trunc_warn = self._get_prior_bounds(normal_stds) if norm_trunc_warn: logging.warning( "Gaussian priors (normal / half-normal) have been truncated" " at {:f} standard deviations for estimating the coverage" " frequency band. If sampling fails at any point, please" " consider manually setting [minCoverFreq,maxCoverFreq] to" " more generous values.".format(normal_stds) ) # first start with parameters that have non-delta prior ranges search_ranges = { key: [bound["lower"], bound["upper"]] for key, bound in prior_bounds.items() } # then add fixed-point (delta prior) parameters for key in self.theta_prior: if key not in self.theta_keys: search_ranges[key] = [self.theta_prior[key]] return search_ranges else: return None def _initiate_search_object(self): logging.info("Setting up search object") search_ranges = self._get_search_ranges() self.search = core.ComputeFstat( tref=self.tref, sftfilepattern=self.sftfilepattern, minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq, search_ranges=search_ranges, detectors=self.detectors, BSGL=self.BSGL, transientWindowType=self.transientWindowType, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, binary=self.binary, injectSources=self.injectSources, assumeSqrtSX=self.assumeSqrtSX, SSBprec=self.SSBprec, RngMedWindow=self.RngMedWindow, tCWFstatMapVersion=self.tCWFstatMapVersion, earth_ephem=self.earth_ephem, sun_ephem=self.sun_ephem, allowedMismatchFromSFTLength=self.allowedMismatchFromSFTLength, ) if self.minStartTime is None: self.minStartTime = self.search.minStartTime if self.maxStartTime is None: self.maxStartTime = self.search.maxStartTime def _logp(self, theta_vals, theta_prior, theta_keys, search): H = [ self._generic_lnprior(**theta_prior[key])(p) for p, key in zip(theta_vals, theta_keys) ] return np.sum(H) def _set_point_for_evaluation(self, theta): """Combines fixed and variable parameters to form a valid evaluation point. Parameters ---------- theta: list or np.ndarray The sampled (variable) parameters. Returns ------- p: list The full parameter space point as a list. """ p = copy.copy(self.fixed_theta) for j, theta_i in enumerate(self.theta_idxs): p[theta_i] = theta[j] return p def _logl(self, theta, search): in_theta = self._set_point_for_evaluation(theta) detstat = search.get_det_stat(*in_theta) return detstat * self.likelihooddetstatmultiplier + self.likelihoodcoef def _unpack_input_theta(self): self.full_theta_keys = ["F0", "F1", "F2", "Alpha", "Delta"] if self.binary: self.full_theta_keys += ["asini", "period", "ecc", "tp", "argp"] full_theta_keys_copy = copy.copy(self.full_theta_keys) self.theta_keys = [] fixed_theta_dict = {} for key, val in self.theta_prior.items(): if type(val) is dict: fixed_theta_dict[key] = 0 self.theta_keys.append(key) elif type(val) in [float, int, np.float64]: fixed_theta_dict[key] = val else: raise ValueError( "Type {} of {} in theta not recognised".format(type(val), key) ) full_theta_keys_copy.pop(full_theta_keys_copy.index(key)) if len(full_theta_keys_copy) > 0: raise ValueError( ("Input dictionary `theta` is missing the" "following keys: {}").format( full_theta_keys_copy ) ) self.fixed_theta = [fixed_theta_dict[key] for key in self.full_theta_keys] self.theta_idxs = [self.full_theta_keys.index(k) for k in self.theta_keys] self.theta_symbols = [self.symbol_dictionary[k] for k in self.theta_keys] idxs = np.argsort(self.theta_idxs) self.theta_idxs = [self.theta_idxs[i] for i in idxs] self.theta_symbols = [self.theta_symbols[i] for i in idxs] self.theta_keys = [self.theta_keys[i] for i in idxs] self.output_keys = self.theta_keys.copy() self.output_keys.append("twoF") if self.BSGL: self.output_keys.append("log10BSGL") def _evaluate_logpost(self, p0vec): init_logp = np.array( [ self._logp(p, self.theta_prior, self.theta_keys, self.search) for p in p0vec ] ) init_logl = np.array([self._logl(p, self.search) for p in p0vec]) return init_logl + init_logp def _check_initial_points(self, p0): for nt in range(self.ntemps): logging.info("Checking temperature {} chains".format(nt)) num = sum(self._evaluate_logpost(p0[nt]) == -np.inf) if num > 0: logging.warning( "Of {} initial values, {} are -np.inf due to the prior".format( len(p0[0]), num ) ) p0 = self._generate_new_p0_to_fix_initial_points(p0, nt) def _generate_new_p0_to_fix_initial_points(self, p0, nt): logging.info("Attempting to correct intial values") init_logpost = self._evaluate_logpost(p0[nt]) idxs = np.arange(self.nwalkers)[init_logpost == -np.inf] count = 0 while sum(init_logpost == -np.inf) > 0 and count < 100: for j in idxs: p0[nt][j] = p0[nt][np.random.randint(0, self.nwalkers)] * ( 1 + np.random.normal(0, 1e-10, self.ndim) ) init_logpost = self._evaluate_logpost(p0[nt]) count += 1 if sum(init_logpost == -np.inf) > 0: logging.info("Failed to fix initial priors") else: logging.info("Suceeded to fix initial priors") return p0
[docs] def setup_initialisation(self, nburn0, scatter_val=1e-10): """Add an initialisation step to the MCMC run If called prior to `run()`, adds an intial step in which the MCMC simulation is run for `nburn0` steps. After this, the MCMC simulation continues in the usual manner (i.e. for nburn and nprod steps), but the walkers are reset scattered around the maximum likelihood position of the initialisation step. Parameters ---------- nburn0: int Number of initialisation steps to take. scatter_val: float Relative number to scatter walkers around the maximum likelihood position after the initialisation step. If the maximum likelihood point is located at `p`, the new walkers are randomly drawn from a multivariate gaussian distribution centered at `p` with standard deviation `diag(scatter_val * p)`. """ logging.info( "Setting up initialisation with nburn0={}, scatter_val={}".format( nburn0, scatter_val ) ) self.nsteps = [nburn0] + self.nsteps self.scatter_val = scatter_val
def _run_sampler(self, p0, nprod=0, nburn=0, window=50): for result in tqdm( self.sampler.sample(p0, iterations=nburn + nprod), total=nburn + nprod ): pass self.mean_acceptance_fraction = np.mean( self.sampler.acceptance_fraction, axis=1 ) logging.info( "Mean acceptance fraction: {}".format(self.mean_acceptance_fraction) ) if self.ntemps > 1: self.tswap_acceptance_fraction = self.sampler.tswap_acceptance_fraction logging.info( "Tswap acceptance fraction: {}".format( self.sampler.tswap_acceptance_fraction ) ) self.autocorr_time = self.sampler.get_autocorr_time(window=window) logging.info("Autocorrelation length: {}".format(self.autocorr_time)) def _estimate_run_time(self): """Print the estimated run time Uses timing coefficients based on a Lenovo T460p Intel(R) Core(TM) i5-6300HQ CPU @ 2.30GHz. """ # Todo: add option to time on a machine, and move coefficients to # ~/.pyfstat.conf if ( type(self.theta_prior["Alpha"]) == dict or type(self.theta_prior["Delta"]) == dict ): tau0LD = 5.2e-7 tau0T = 1.5e-8 tau0S = 1.2e-4 tau0C = 5.8e-6 else: tau0LD = 1.3e-7 tau0T = 1.5e-8 tau0S = 9.1e-5 tau0C = 5.5e-6 Nsfts = (self.maxStartTime - self.minStartTime) / 1800.0 if hasattr(self, "run_setup"): ts = [] for row in self.run_setup: nsteps = row[0] nsegs = row[1] numb_evals = np.sum(nsteps) * self.nwalkers * self.ntemps t = (tau0S + tau0LD * Nsfts) * numb_evals if nsegs > 1: t += (tau0C + tau0T * Nsfts) * nsegs * numb_evals ts.append(t) time = np.sum(ts) else: numb_evals = np.sum(self.nsteps) * self.nwalkers * self.ntemps time = (tau0S + tau0LD * Nsfts) * numb_evals if getattr(self, "nsegs", 1) > 1: time += (tau0C + tau0T * Nsfts) * self.nsegs * numb_evals logging.info( "Estimated run-time = {} s = {:1.0f}:{:1.0f} m".format( time, *divmod(time, 60) ) )
[docs] def run( self, proposal_scale_factor=2, save_pickle=True, export_samples=True, save_loudest=True, plot_walkers=True, walker_plot_args=None, window=50, ): """Run the MCMC simulatation Parameters ---------- proposal_scale_factor: float The proposal scale factor `a > 1` used by the sampler. See Goodman & Weare (Comm App Math Comp Sci, Vol 5, No. 1, 2010): 10.2140/camcos.2010.5.65. The bigger the value, the wider the range to draw proposals from. If the acceptance fraction is too low, you can raise it by decreasing the `a` parameter; and if it is too high, you can reduce it by increasing the `a` parameter. See Foreman-Mackay et al. (PASP 125 306, 2013): https://arxiv.org/abs/1202.3665. save_pickle: bool If true, save a pickle file of the full sampler state. export_samples: bool If true, save ASCII samples file to disk. See `MCMCSearch.export_samples_to_disk`. save_loudest: bool If true, save a CFSv2 .loudest file to disk. See `MCMCSearch.generate_loudest`. plot_walkers: bool If true, save trace plots of the walkers. walker_plot_args: Dictionary passed as kwargs to _plot_walkers to control the plotting. Histogram of sampled detection statistic values can be retrieved setting "plot_det_stat" to `True`. Parameters corresponding to an injected signal can be passed through "injection_parameters" as a dictionary containing the parameters of said signal. All parameters being searched for must be present, otherwise this option is ignored. If both "fig" and "axes" entries are set, the plot is not saved to disk directly, but (fig, axes) are returned. window: int The minimum number of autocorrelation times needed to trust the result when estimating the autocorrelation time (see ptemcee.Sampler.get_autocorr_time for further details. """ self._initiate_search_object() self.old_data_is_okay_to_use = self._check_old_data_is_okay_to_use() if self.old_data_is_okay_to_use is True: logging.warning("Using saved data from {}".format(self.pickle_path)) d = self.get_saved_data_dictionary() self.samples = d["samples"] self.lnprobs = d["lnprobs"] self.lnlikes = d["lnlikes"] self.all_lnlikelihood = d["all_lnlikelihood"] self.chain = d["chain"] return self._estimate_run_time() walker_plot_args = walker_plot_args or {} self.sampler = PTSampler( ntemps=self.ntemps, nwalkers=self.nwalkers, dim=self.ndim, logl=self._logl, logp=self._logp, logpargs=(self.theta_prior, self.theta_keys, self.search), loglargs=(self.search,), betas=self.betas, a=proposal_scale_factor, ) p0 = self._generate_initial_p0() p0 = self._apply_corrections_to_p0(p0) self._check_initial_points(p0) # Run initialisation steps if required ninit_steps = len(self.nsteps) - 2 for j, n in enumerate(self.nsteps[:-2]): logging.info( "Running {}/{} initialisation with {} steps".format(j, ninit_steps, n) ) self._run_sampler(p0, nburn=n, window=window) if plot_walkers: try: walker_fig, walker_axes = self._plot_walkers(**walker_plot_args) walker_fig.tight_layout() walker_fig.savefig( os.path.join( self.outdir, "{}_init_{}_walkers.png".format(self.label, j) ) ) plt.close(walker_fig) except Exception as e: logging.warning( "Failed to plot initialisation walkers due to Error {}".format( e ) ) p0 = self._get_new_p0() p0 = self._apply_corrections_to_p0(p0) self._check_initial_points(p0) self.sampler.reset() if len(self.nsteps) > 1: nburn = self.nsteps[-2] else: nburn = 0 nprod = self.nsteps[-1] logging.info("Running final burn and prod with {} steps".format(nburn + nprod)) self._run_sampler(p0, nburn=nburn, nprod=nprod) samples = self.sampler.chain[0, :, nburn:, :].reshape((-1, self.ndim)) lnprobs = self.sampler.logprobability[0, :, nburn:].reshape((-1)) lnlikes = self.sampler.loglikelihood[0, :, nburn:].reshape((-1)) all_lnlikelihood = self.sampler.loglikelihood[:, :, nburn:] self.samples = samples self.chain = self.sampler.chain self.lnprobs = lnprobs self.lnlikes = lnlikes self.all_lnlikelihood = all_lnlikelihood if save_pickle: self._pickle_data(samples, lnprobs, lnlikes, all_lnlikelihood) if export_samples: self.export_samples_to_disk() if save_loudest: self.generate_loudest() if plot_walkers: try: walkers_fig, walkers_axes = self._plot_walkers( nprod=nprod, **walker_plot_args ) walkers_fig.tight_layout() except Exception as e: logging.warning("Failed to plot walkers due to Error {}".format(e)) if (walker_plot_args.get("fig") is not None) and ( walker_plot_args.get("axes") is not None ): self.walker_fig = walkers_fig self.walker_axes = walkers_axes else: try: walkers_fig.savefig( os.path.join(self.outdir, self.label + "_walkers.png") ) plt.close(walkers_fig) except Exception as e: logging.warning( "Failed to save walker plots due to Error {}".format(e) )
def _get_rescale_multiplier_for_key(self, key): """Get the rescale multiplier from the transform_dictionary Can either be a float, a string (in which case it is interpretted as a attribute of the MCMCSearch class, e.g. minStartTime, or non-existent in which case 0 is returned """ if key not in self.transform_dictionary: return 1 if "multiplier" in self.transform_dictionary[key]: val = self.transform_dictionary[key]["multiplier"] if type(val) == str: if hasattr(self, val): multiplier = getattr( self, self.transform_dictionary[key]["multiplier"] ) else: raise ValueError("multiplier {} not a class attribute".format(val)) else: multiplier = val else: multiplier = 1 return multiplier def _get_rescale_subtractor_for_key(self, key): """Get the rescale subtractor from the transform_dictionary Can either be a float, a string (in which case it is interpretted as a attribute of the MCMCSearch class, e.g. minStartTime, or non-existent in which case 0 is returned """ if key not in self.transform_dictionary: return 0 if "subtractor" in self.transform_dictionary[key]: val = self.transform_dictionary[key]["subtractor"] if type(val) == str: if hasattr(self, val): subtractor = getattr( self, self.transform_dictionary[key]["subtractor"] ) else: raise ValueError("subtractor {} not a class attribute".format(val)) else: subtractor = val else: subtractor = 0 return subtractor def _scale_samples(self, samples, theta_keys): """Scale the samples using the transform_dictionary""" for key in theta_keys: if key in self.transform_dictionary: idx = theta_keys.index(key) s = samples[:, idx] subtractor = self._get_rescale_subtractor_for_key(key) s = s - subtractor multiplier = self._get_rescale_multiplier_for_key(key) s *= multiplier samples[:, idx] = s return samples def _get_labels(self, newline_units=False): """Combine the units, symbols and rescaling to give labels""" labels = [] for key in self.theta_keys: values = self.transform_dictionary.get(key, {}) s, label, u = [ values.get(slu_key, None) for slu_key in ["symbol", "label", "unit"] ] if label is None: s = s or self.symbol_dictionary[key].replace( "_{glitch}", r"_\mathrm{glitch}" ) u = u or self.unit_dictionary[key] label = ( f"{s}" + ("\n" if newline_units else " ") + (f"[{u}]" if u != "" else "") ) labels.append(label) return labels
[docs] def plot_corner( self, figsize=(10, 10), add_prior=False, nstds=None, label_offset=0.4, dpi=300, rc_context={}, tglitch_ratio=False, fig_and_axes=None, save_fig=True, **kwargs, ): """Generate a corner plot of the posterior Using the `corner` package (https://pypi.python.org/pypi/corner/), generate estimates of the posterior from the production samples. Parameters ---------- figsize: tuple (7, 7) Figure size in inches (passed to plt.subplots) add_prior: bool, str If true, plot the prior as a red line. If 'full' then for uniform priors plot the full extent of the prior. nstds: float The number of standard deviations to plot centered on the median. Standard deviation is computed from the samples using `numpy.std`. label_offset: float Offset the labels from the plot: useful to prevent overlapping the tick labels with the axis labels. This option is passed to `ax.[x|y]axis.set_label_coords`. dpi: int Passed to plt.savefig. rc_context: dict Dictionary of rc values to set while generating the figure (see matplotlib rc for more details). tglitch_ratio: bool If true, and tglitch is a parameter, plot posteriors as the fractional time at which the glitch occurs instead of the actual time. fig_and_axes: tuple (fig, axes) tuple to plot on. The axes must be of the right shape, namely (ndim, ndim) save_fig: bool If true, save the figure, else return the fig, axes. **kwargs: Passed to corner.corner. Use "truths" to plot the true parameters of a signal. Returns ------- fig, axes: The matplotlib figure and axes, only returned if save_fig = False. """ if "truths" in kwargs: if not isinstance(kwargs["truths"], dict): raise ValueError("'truths' must be a dictionary.") missing_keys = set(self.theta_keys) - kwargs["truths"].keys() if missing_keys: logging.warning( f"plot_corner(): Missing keys {missing_keys} in 'truths' dictionary," " argument will be ignored." ) kwargs["truths"] = None else: kwargs["truths"] = [kwargs["truths"][key] for key in self.theta_keys] kwargs["truths"] = self._scale_samples( np.reshape(kwargs["truths"], (1, -1)), self.theta_keys ).ravel() if "truth_color" not in kwargs: kwargs["truth_color"] = "black" if self.ndim < 2: with plt.rc_context(rc_context): if fig_and_axes is None: fig, ax = plt.subplots(figsize=figsize) else: fig, ax = fig_and_axes ax.hist(self.samples, bins=50, histtype="stepfilled") ax.set_xlabel(self.theta_symbols[0]) fig.savefig(os.path.join(self.outdir, self.label + "_corner.png"), dpi=dpi) plt.close(fig) return with plt.rc_context(rc_context): if fig_and_axes is None: fig, axes = plt.subplots(self.ndim, self.ndim, figsize=figsize) else: fig, axes = fig_and_axes samples_plt = copy.copy(self.samples) labels = self._get_labels(newline_units=False) samples_plt = self._scale_samples(samples_plt, self.theta_keys) if tglitch_ratio: for j, k in enumerate(self.theta_keys): if k == "tglitch": s = samples_plt[:, j] samples_plt[:, j] = (s - self.minStartTime) / ( self.maxStartTime - self.minStartTime ) labels[j] = r"$R_{\mathrm{glitch}}$" if type(nstds) is int and "range" not in kwargs: _range = [] for j, s in enumerate(samples_plt.T): median = np.median(s) std = np.std(s) _range.append((median - nstds * std, median + nstds * std)) elif "range" in kwargs: _range = kwargs.pop("range") else: _range = None hist_kwargs = kwargs.pop("hist_kwargs", dict()) if "density" not in hist_kwargs: hist_kwargs["density"] = True fig_triangle = corner.corner( samples_plt, labels=labels, fig=fig, bins=50, max_n_ticks=4, plot_contours=True, plot_datapoints=True, label_kwargs={"fontsize": 12}, data_kwargs={"alpha": 0.1, "ms": 0.5}, range=_range, hist_kwargs=hist_kwargs, show_titles=True, fill_contours=True, quantiles=[0.05, 0.95] if "quantiles" not in kwargs else kwargs.pop("quantiles"), verbose=True if "verbose" not in kwargs else kwargs.pop("verbose"), **kwargs, ) axes_list = fig_triangle.get_axes() axes = np.array(axes_list).reshape(self.ndim, self.ndim) plt.draw() for ax in axes[:, 0]: ax.yaxis.set_label_coords(-label_offset, 0.5) for ax in axes[-1, :]: ax.xaxis.set_label_coords(0.5, -label_offset) for ax in axes_list: ax.set_rasterized(True) ax.set_rasterization_zorder(-10) for tick in ax.xaxis.get_major_ticks(): # tick.label1.set_fontsize(8) tick.label1.set_rotation(30) for tick in ax.yaxis.get_major_ticks(): # tick.label1.set_fontsize(8) tick.label1.set_rotation(30) plt.tight_layout() fig.subplots_adjust(hspace=0.1, wspace=0.1) if add_prior: self._add_prior_to_corner(axes, self.samples, add_prior) if save_fig: fig_triangle.savefig( os.path.join(self.outdir, self.label + "_corner.png"), dpi=dpi ) plt.close(fig_triangle) else: return fig, axes
[docs] def plot_chainconsumer(self, save_fig=True, label_offset=0.25, dpi=300, **kwargs): """Generate a corner plot of the posterior using the `chaniconsumer` package. `chainconsumer` is an optional dependency of PyFstat. See https://samreay.github.io/ChainConsumer/. Parameters are akin to the ones described in MCMCSearch.plot_corner. Only the differing parameters are explicitly described. Parameters ---------- **kwargs: Passed to chainconsumer.plotter.plot. Use "truths" to plot the true parameters of a signal. """ try: import chainconsumer except ImportError: logging.warning( "Could not import 'chainconsumer' package, please install it to use this method." ) return samples_plt = copy.copy(self.samples) labels = self._get_labels(newline_units=True) samples_plt = self._scale_samples(samples_plt, self.theta_keys) if "truth" in kwargs: if not isinstance(kwargs["truth"], dict): raise ValueError("'truth' must be a dictionary.") missing_keys = np.setdiff1d(self.theta_keys, list(kwargs["truth"].keys())) if len(missing_keys) > 0: logging.warning( "plot_chainconsumer(): Missing keys {} in 'truth' dictionary," " argument will be ignored.".format(missing_keys) ) kwargs["truth"] = None else: parameters_in_order = np.array( [kwargs["truth"][key] for key in self.theta_keys] ).reshape((1, -1)) kwargs["truth"] = self._scale_samples( parameters_in_order, self.theta_keys ).ravel() c = chainconsumer.ChainConsumer() c.add_chain(samples_plt, parameters=labels) # We set usetex=False to avoid dependency on 'kpsewhich' TeX tool c.configure(smooth=0, summary=False, sigma2d=True, usetex=False) fig = c.plotter.plot(**kwargs) axes_list = fig.get_axes() axes = np.array(axes_list).reshape(self.ndim, self.ndim) plt.draw() for ax in axes[:, 0]: ax.yaxis.set_label_coords(-label_offset, 0.5) for ax in axes[-1, :]: ax.xaxis.set_label_coords(0.5, -label_offset) for ax in axes_list: ax.set_rasterized(True) ax.set_rasterization_zorder(-10) plt.tight_layout(h_pad=0.0, w_pad=0.0) fig.subplots_adjust(hspace=0.05, wspace=0.05) if save_fig: fig.savefig( os.path.join(self.outdir, self.label + "_chainconsumer_corner.png"), dpi=dpi, ) plt.close(fig) else: return fig, axes
def _add_prior_to_corner(self, axes, samples, add_prior): for i, key in enumerate(self.theta_keys): ax = axes[i][i] s = samples[:, i] lnprior = self._generic_lnprior(**self.theta_prior[key]) if add_prior == "full" and self.theta_prior[key]["type"] == "unif": lower = self.theta_prior[key]["lower"] upper = self.theta_prior[key]["upper"] r = upper - lower xlim = [lower - 0.05 * r, upper + 0.05 * r] x = np.linspace(xlim[0], xlim[1], 1000) else: xlim = ax.get_xlim() x = np.linspace(s.min(), s.max(), 1000) multiplier = self._get_rescale_multiplier_for_key(key) subtractor = self._get_rescale_subtractor_for_key(key) ax.plot( (x - subtractor) * multiplier, [np.exp(lnprior(xi)) for xi in x], "-C3", label="prior", ) for j in range(i, self.ndim): axes[j][i].set_xlim(xlim[0], xlim[1]) for k in range(0, i): axes[i][k].set_ylim(xlim[0], xlim[1]) def _get_prior_bounds(self, normal_stds=2): """Get the lower/upper bounds of all priors Parameters ---------- normal_stds: float Number of standard deviations to cut normal (Gaussian) or half-norm distributions at. Returns ------- prior_bounds: dict Dictionary of ["lower","upper"] pairs for each parameter norm_warning: bool A flag that is true if any parameter has a norm or half-norm prior. Caller functions may wish to warn the user that the prior has been truncated at normal_stds. """ prior_bounds = {} norm_trunc_warning = False for key in self.theta_keys: prior_bounds[key] = {} prior_dict = self.theta_prior[key] norm_trunc_warning = "norm" in prior_dict["type"] or norm_trunc_warning if prior_dict["type"] == "unif": prior_bounds[key]["lower"] = prior_dict["lower"] prior_bounds[key]["upper"] = prior_dict["upper"] elif prior_dict["type"] == "log10unif": prior_bounds[key]["lower"] = 10 ** prior_dict["log10lower"] prior_bounds[key]["upper"] = 10 ** prior_dict["log10upper"] elif prior_dict["type"] == "norm": prior_bounds[key]["lower"] = ( prior_dict["loc"] - normal_stds * prior_dict["scale"] ) prior_bounds[key]["upper"] = ( prior_dict["loc"] + normal_stds * prior_dict["scale"] ) elif prior_dict["type"] == "halfnorm": prior_bounds[key]["lower"] = prior_dict["loc"] prior_bounds[key]["upper"] = ( prior_dict["loc"] + normal_stds * prior_dict["scale"] ) elif prior_dict["type"] == "neghalfnorm": prior_bounds[key]["upper"] = prior_dict["loc"] prior_bounds[key]["lower"] = ( prior_dict["loc"] - normal_stds * prior_dict["scale"] ) elif prior_dict["type"] == "lognorm": prior_bounds[key]["lower"] = np.exp( prior_dict["loc"] - normal_stds * prior_dict["scale"] ) prior_bounds[key]["upper"] = np.exp( prior_dict["loc"] + normal_stds * prior_dict["scale"] ) else: raise ValueError( "Not implemented for prior type {}".format(prior_dict["type"]) ) return prior_bounds, norm_trunc_warning
[docs] def plot_prior_posterior( self, normal_stds=2, injection_parameters=None, fig_and_axes=None, save_fig=True, ): """Plot the prior and posterior probability distributions in the same figure Parameters ---------- normal_stds: int Bounds of priors in terms of their standard deviation. Only used if `norm`, `halfnorm`, `neghalfnorm` or `lognorm` priors are given, otherwise ignored. injection_parameters: dict Dictionary containing the parameters of a signal. All parameters being searched must be present as dictionary keys, otherwise this option is ignored. fig_and_axes: tuple (fig, axes) tuple to plot on. save_fig: bool If true, save the figure, else return the fig, axes. Returns ------- (fig, ax): (matplotlib.pyplot.figure, matplotlib.pyplot.axes) If `save_fig` evaluates to `False`, return figure and axes. """ # Check injection parameters first injection_parameters = injection_parameters or {} missing_keys = set(self.theta_keys) - injection_parameters.keys() if missing_keys: logging.warning( f"plot_prior_posterior(): Missing keys {missing_keys} in 'injection_parameters'," " no injection parameters will be highlighted." ) injection_parameters = None if fig_and_axes is None: fig, axes = plt.subplots(nrows=self.ndim, figsize=(8, 4 * self.ndim)) else: fig, ax = fig_and_axes if self.ndim == 1: axes = [axes] N = 1000 from scipy.stats import gaussian_kde prior_bounds, _ = self._get_prior_bounds(normal_stds) for i, (ax, key) in enumerate(zip(axes, self.theta_keys)): prior_dict = self.theta_prior[key] ln_prior_func = self._generic_lnprior(**prior_dict) x = np.linspace(prior_bounds[key]["lower"], prior_bounds[key]["upper"], N) prior = np.exp([ln_prior_func(xi) for xi in x]) # may not be vectorized priorln = ax.plot(x, prior, "C3", label="prior") ax.set(xlabel=self.theta_symbols[i], yticks=[]) s = self.samples[:, i] while len(s) > 10**4: # random downsample to avoid slow calculation of kde s = np.random.choice(s, size=int(len(s) / 2.0)) kde = gaussian_kde(s) ax2 = ax.twinx() postln = ax2.plot(x, kde.pdf(x), "k", label="posterior") ax2.set(yticks=[], yticklabels=[]) if injection_parameters is not None: injection = ax.axvline( injection_parameters[key], label="Injection", color="purple", ls="--", ) plotlines = priorln + postln labs = [plotline.get_label() for plotline in plotlines] if injection_parameters is not None: plotlines.append(injection) labs.append("injection") axes[0].legend(plotlines, labs, loc=1, framealpha=0.8) if save_fig: fig.savefig(os.path.join(self.outdir, self.label + "_prior_posterior.png")) plt.close(fig) else: return fig, axes
[docs] def plot_cumulative_max(self, **kwargs): """Plot the cumulative twoF for the maximum posterior estimate. This method accepts the same arguments as `pyfstat.core.ComputeFstat.plot_twoF_cumulative`, except for `CFS_input`, which is taken from the loudest candidate; and `label` and `outdir`, which are taken from the instance of this class. For example, one can pass signal arguments to predic_twoF_cumulative through `PFS_kwargs`, or set the number of segments using `num_segments_(CFS|PFS)`. The same applies for other options such as `tstart`, `tend` or `savefig`. Every single of these arguments will be passed to `pyfstat.core.ComputeFstat.plot_twoF_cumulative` as they are, using their default argument otherwise. See `pyfstat.core.ComputeFstat.plot_twoF_cumulative` for a comprehensive list of accepted arguments and their default values. Unlike the core function, here savefig=True is the default, for consistency with other MCMC plotting functions. """ logging.info("Getting cumulative 2F") d, maxtwoF = self.get_max_twoF() for key, val in self.theta_prior.items(): if key not in d: d[key] = val if kwargs.get("savefig") is None: kwargs["savefig"] = True self.search.plot_twoF_cumulative( CFS_input=d, label=self.label, outdir=self.outdir, **kwargs )
def _generic_lnprior(self, **kwargs): """Return a lambda function of the pdf Parameters ---------- **kwargs: A dictionary containing 'type' of pdf and shape parameters """ def log_of_unif(x, a, b): above = x < b below = x > a if type(above) is not np.ndarray: if above and below: return -np.log(b - a) else: return -np.inf else: idxs = np.array([all(tup) for tup in zip(above, below)]) p = np.zeros(len(x)) - np.inf p[idxs] = -np.log(b - a) return p def log_of_log10unif(x, log10lower, log10upper): log10x = np.log10(x) above = log10x < log10upper below = log10x > log10lower if type(above) is not np.ndarray: if above and below: return -np.log(x * np.log(10) * (log10upper - log10lower)) else: return -np.inf else: idxs = np.array([all(tup) for tup in zip(above, below)]) p = np.zeros(len(x)) - np.inf p[idxs] = -np.log(x * np.log(10) * (log10upper - log10lower)) return p def log_of_halfnorm(x, loc, scale): if x < loc: return -np.inf else: return -0.5 * ( (x - loc) ** 2 / scale**2 + np.log(0.5 * np.pi * scale**2) ) def cauchy(x, x0, gamma): return 1.0 / (np.pi * gamma * (1 + ((x - x0) / gamma) ** 2)) def exp(x, x0, gamma): if x > x0: return np.log(gamma) - gamma * (x - x0) else: return -np.inf if kwargs["type"] == "unif": return lambda x: log_of_unif(x, kwargs["lower"], kwargs["upper"]) if kwargs["type"] == "log10unif": return lambda x: log_of_log10unif( x, kwargs["log10lower"], kwargs["log10upper"] ) elif kwargs["type"] == "halfnorm": return lambda x: log_of_halfnorm(x, kwargs["loc"], kwargs["scale"]) elif kwargs["type"] == "neghalfnorm": return lambda x: log_of_halfnorm(-x, kwargs["loc"], kwargs["scale"]) elif kwargs["type"] == "norm": return lambda x: -0.5 * ( (x - kwargs["loc"]) ** 2 / kwargs["scale"] ** 2 + np.log(2 * np.pi * kwargs["scale"] ** 2) ) elif kwargs["type"] == "lognorm": # as of scipy 1.4.1 and numpy 1.18.1 the following parametrisation # should be consistent with np.random.lognormal in _generate_rv() return lambda x: lognorm.pdf( x, s=kwargs["scale"], scale=np.exp(kwargs["loc"]) ) else: logging.info("kwargs:", kwargs) raise ValueError("Prior pdf type {:s} unknown.".format(kwargs["type"])) def _generate_rv(self, **kwargs): dist_type = kwargs.pop("type") if dist_type == "unif": return np.random.uniform(low=kwargs["lower"], high=kwargs["upper"]) if dist_type == "log10unif": return 10 ** ( np.random.uniform(low=kwargs["log10lower"], high=kwargs["log10upper"]) ) if dist_type == "norm": return np.random.normal(loc=kwargs["loc"], scale=kwargs["scale"]) if dist_type == "halfnorm": return np.abs(np.random.normal(loc=kwargs["loc"], scale=kwargs["scale"])) if dist_type == "neghalfnorm": return -1 * np.abs( np.random.normal(loc=kwargs["loc"], scale=kwargs["scale"]) ) if dist_type == "lognorm": return np.random.lognormal(mean=kwargs["loc"], sigma=kwargs["scale"]) else: raise ValueError("dist_type {} unknown".format(dist_type)) def _plot_walkers( self, symbols=None, alpha=0.8, color="k", temp=0, lw=0.1, nprod=0, add_det_stat_burnin=False, fig=None, axes=None, xoffset=0, injection_parameters=None, plot_det_stat=False, context="ggplot", labelpad=5, ): """Plot all the chains from a sampler""" if injection_parameters is not None: if not isinstance(injection_parameters, dict): raise ValueError("injection_parameters is not a dictionary") missing_keys = set(self.theta_keys) - injection_parameters.keys() if missing_keys: logging.warning( f"plot_walkers(): Missing keys {missing_keys} in 'injection_parameters'," " argument will be ignored." ) injection_parameters = None else: scaled_injection_parameters = { key: ( injection_parameters[key] - self._get_rescale_subtractor_for_key(key) ) * self._get_rescale_multiplier_for_key(key) for key in injection_parameters.keys() } if symbols is None: symbols = self._get_labels() if context not in plt.style.available: raise ValueError( ( "The requested context {} is not available; please select a" " context from `plt.style.available`" ).format(context) ) if np.ndim(axes) > 1: axes = axes.flatten() shape = self.sampler.chain.shape if len(shape) == 3: nwalkers, nsteps, ndim = shape chain = self.sampler.chain[:, :, :].copy() if len(shape) == 4: ntemps, nwalkers, nsteps, ndim = shape if temp < ntemps: logging.info("Plotting temperature {} chains".format(temp)) else: raise ValueError( ("Requested temperature {} outside of" "available range").format( temp ) ) chain = self.sampler.chain[temp, :, :, :].copy() samples = chain.reshape((nwalkers * nsteps, ndim)) samples = self._scale_samples(samples, self.theta_keys) chain = chain.reshape((nwalkers, nsteps, ndim)) if plot_det_stat: extra_subplots = 1 else: extra_subplots = 0 with plt.style.context((context)): if fig is None and axes is None: fig = plt.figure(figsize=(4, 3.0 * ndim)) ax = fig.add_subplot(ndim + extra_subplots, 1, 1) axes = [ax] + [ fig.add_subplot(ndim + extra_subplots, 1, i) for i in range(2, ndim + 1) ] idxs = np.arange(chain.shape[1]) burnin_idx = chain.shape[1] - nprod last_idx = burnin_idx if ndim > 1: for i in range(ndim): axes[i].ticklabel_format(useOffset=False, axis="y") cs = chain[:, :, i].T if burnin_idx > 0: axes[i].plot( xoffset + idxs[: last_idx + 1], cs[: last_idx + 1], color="C3", alpha=alpha, lw=lw, ) axes[i].axvline(xoffset + last_idx, color="k", ls="--", lw=0.5) axes[i].plot( xoffset + idxs[burnin_idx:], cs[burnin_idx:], color="k", alpha=alpha, lw=lw, ) if injection_parameters is not None: axes[i].axhline( scaled_injection_parameters[self.theta_keys[i]], ls="--", lw=2.0, color="orange", ) axes[i].set_xlim(0, xoffset + idxs[-1]) if symbols: axes[i].set_ylabel(symbols[i], labelpad=labelpad) else: axes[0].ticklabel_format(useOffset=False, axis="y") cs = chain[:, :, temp].T if burnin_idx: axes[0].plot( idxs[:burnin_idx], cs[:burnin_idx], color="C3", alpha=alpha, lw=lw, ) axes[0].plot( idxs[burnin_idx:], cs[burnin_idx:], color="k", alpha=alpha, lw=lw ) if injection_parameters is not None: axes[0].axhline( scaled_injection_parameters[self.theta_keys[0]], ls="--", lw=5.0, color="orange", ) if symbols: axes[0].set_ylabel(symbols[0], labelpad=labelpad) axes[-1].set_xlabel(r"Number of steps", labelpad=0.2) if plot_det_stat: if len(axes) == ndim: axes.append(fig.add_subplot(ndim + 1, 1, ndim + 1)) lnl = self.sampler.loglikelihood[temp, :, :] if burnin_idx and add_det_stat_burnin: burn_in_vals = lnl[:, :burnin_idx].flatten() try: detstat_burnin = ( burn_in_vals[~np.isnan(burn_in_vals)] - self.likelihoodcoef ) / self.likelihooddetstatmultiplier axes[-1].hist( detstat_burnin, bins=50, histtype="step", color="C3" ) except ValueError: logging.info( "Histogram of detection statistic failed, " "most likely all values were the same." ) pass else: detstat_burnin = [] prod_vals = lnl[:, burnin_idx:].flatten() try: detstat = ( prod_vals[~np.isnan(prod_vals)] - self.likelihoodcoef ) / self.likelihooddetstatmultiplier axes[-1].hist(detstat, bins=50, histtype="step", color="k") except ValueError: logging.info( "Histogram of detection statistic failed, " "most likely all values were the same." ) pass if self.BSGL: axes[-1].set_xlabel(r"$\log_{10}\mathcal{B}_\mathrm{S/GL}$") else: axes[-1].set_xlabel(r"$\widetilde{2\mathcal{F}}$") axes[-1].set_ylabel(r"$\mathrm{Counts}$") combined_vals = np.append(detstat_burnin, detstat) if len(combined_vals) > 0: minv = np.min(combined_vals) maxv = np.max(combined_vals) Range = abs(maxv - minv) axes[-1].set_xlim(minv - 0.1 * Range, maxv + 0.1 * Range) xfmt = matplotlib.ticker.ScalarFormatter() xfmt.set_powerlimits((-4, 4)) axes[-1].xaxis.set_major_formatter(xfmt) return fig, axes def _apply_corrections_to_p0(self, p0): """Apply any correction to the initial p0 values""" return p0 def _generate_scattered_p0(self, p): """Generate a set of p0s scattered about p""" p0 = [ [ p + self.scatter_val * p * np.random.randn(self.ndim) for i in range(self.nwalkers) ] for j in range(self.ntemps) ] return p0 def _generate_initial_p0(self): """Generate a set of init vals for the walkers""" if type(self.theta_initial) == dict: logging.info("Generate initial values from initial dictionary") if hasattr(self, "nglitch") and self.nglitch > 1: raise ValueError("Initial dict not implemented for nglitch>1") p0 = [ [ [ self._generate_rv(**self.theta_initial[key]) for key in self.theta_keys ] for i in range(self.nwalkers) ] for j in range(self.ntemps) ] elif self.theta_initial is None: logging.info("Generate initial values from prior dictionary") p0 = [ [ [ self._generate_rv(**self.theta_prior[key]) for key in self.theta_keys ] for i in range(self.nwalkers) ] for j in range(self.ntemps) ] else: raise ValueError("theta_initial not understood") return p0 def _get_new_p0(self): """Returns new initial positions for walkers are burn0 stage This returns new positions for all walkers by scattering points about the maximum posterior with scale `scatter_val`. """ temp_idx = 0 pF = self.sampler.chain[temp_idx, :, :, :] lnl = self.sampler.loglikelihood[temp_idx, :, :] lnp = self.sampler.logprobability[temp_idx, :, :] # General warnings about the state of lnp if np.any(np.isnan(lnp)): logging.warning( "Of {} lnprobs {} are nan".format(np.shape(lnp), np.sum(np.isnan(lnp))) ) if np.any(np.isposinf(lnp)): logging.warning( "Of {} lnprobs {} are +np.inf".format( np.shape(lnp), np.sum(np.isposinf(lnp)) ) ) if np.any(np.isneginf(lnp)): logging.warning( "Of {} lnprobs {} are -np.inf".format( np.shape(lnp), np.sum(np.isneginf(lnp)) ) ) lnp_finite = copy.copy(lnp) lnp_finite[np.isinf(lnp)] = np.nan idx = np.unravel_index(np.nanargmax(lnp_finite), lnp_finite.shape) p = pF[idx] p0 = self._generate_scattered_p0(p) logging.info( ( "Gen. new p0 from pos {} which had det. stat.={:2.1f}" " and lnp={:2.1f}" ).format(idx[1], lnl[idx], lnp_finite[idx]) ) return p0 def _get_data_dictionary_to_save(self): d = dict( nsteps=self.nsteps, nwalkers=self.nwalkers, ntemps=self.ntemps, theta_keys=self.theta_keys, theta_prior=self.theta_prior, log10beta_min=self.log10beta_min, BSGL=self.BSGL, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, ) return d def _pickle_data(self, samples, lnprobs, lnlikes, all_lnlikelihood): d = self._get_data_dictionary_to_save() d["samples"] = samples d["lnprobs"] = lnprobs d["lnlikes"] = lnlikes d["chain"] = self.sampler.chain d["all_lnlikelihood"] = all_lnlikelihood if os.path.isfile(self.pickle_path): logging.info( "Saving backup of {} as {}.old".format( self.pickle_path, self.pickle_path ) ) os.rename(self.pickle_path, self.pickle_path + ".old") with open(self.pickle_path, "wb") as File: pickle.dump(d, File)
[docs] def get_saved_data_dictionary(self): """Read the data saved in `self.pickel_path` and return it as a dictionary. Returns -------- d: dict Dictionary containing the data saved in the pickle `self.pickle_path`. """ with open(self.pickle_path, "rb") as File: d = pickle.load(File) return d
def _check_old_data_is_okay_to_use(self): if os.path.isfile(self.pickle_path) is False: logging.info("No pickled data found") return False if self.sftfilepattern is not None: oldest_sft = min( [os.path.getmtime(f) for f in self._get_list_of_matching_sfts()] ) if os.path.getmtime(self.pickle_path) < oldest_sft: logging.info("Pickled data outdates sft files") return False old_d = self.get_saved_data_dictionary().copy() new_d = self._get_data_dictionary_to_save().copy() old_d.pop("samples") old_d.pop("lnprobs") old_d.pop("lnlikes") old_d.pop("all_lnlikelihood") old_d.pop("chain") for key in "minStartTime", "maxStartTime": if new_d[key] is None: new_d[key] = old_d[key] setattr(self, key, new_d[key]) mod_keys = [] for key in list(new_d.keys()): if key in old_d: if new_d[key] != old_d[key]: mod_keys.append((key, old_d[key], new_d[key])) else: raise ValueError("Keys {} not in old dictionary".format(key)) if len(mod_keys) == 0: return True else: logging.warning("Saved data differs from requested") logging.info("Differences found in following keys:") for key in mod_keys: if len(key) == 3: if np.isscalar(key[1]) or key[0] == "nsteps": logging.info(" {} : {} -> {}".format(*key)) else: logging.info(" " + key[0]) else: logging.info(key) return False def _get_savetxt_fmt_dict(self): fmt_dict = helper_functions.get_doppler_params_output_format(self.theta_keys) fmt_dict["twoF"] = "%.9g" if self.BSGL: fmt_dict["log10BSGL"] = "%.9g" return fmt_dict def _get_savetxt_gmt_list(self): """Returns a list of output format specifiers, ordered like the samples This is required because the output of _get_savetxt_fmt_dict() will depend on the order in which those entries have been coded up. """ fmt_dict = self._get_savetxt_fmt_dict() fmt_list = [fmt_dict[key] for key in self.output_keys] return fmt_list
[docs] def export_samples_to_disk(self): """ Export MCMC samples into a text file using `numpy.savetxt`. """ self.samples_file = os.path.join(self.outdir, self.label + "_samples.dat") logging.info("Exporting samples to {}".format(self.samples_file)) header = "\n".join(self.output_file_header) header += "\n" + " ".join(self.output_keys) outfmt = self._get_savetxt_gmt_list() samples_out = copy.copy(self.samples) # For convenience, we always save a twoF column, # even if log10BSGL was used for the likelihood. detstat = np.atleast_2d(self._get_detstat_from_loglikelihood()).T if self.BSGL: twoF = np.zeros_like(detstat) self.search.BSGL = False for idx, samp in enumerate(self.samples): p = self._set_point_for_evaluation(samp) if isinstance(p, dict): twoF[idx] = self.search.get_det_stat(**p) else: twoF[idx] = self.search.get_det_stat(*p) self.search.BSGL = self.BSGL samples_out = np.concatenate((samples_out, twoF), axis=1) # TODO: add single-IFO F-stats? samples_out = np.concatenate((samples_out, detstat), axis=1) Ncols = np.shape(samples_out)[1] if len(outfmt) != Ncols: raise RuntimeError( "Lengths of data rows ({:d})" " and output format ({:d})" " do not match." " If your search class uses different" " keys than the base MCMCSearch class," " override the _get_savetxt_fmt_dict" " method.".format(Ncols, len(outfmt)) ) np.savetxt( self.samples_file, samples_out, delimiter=" ", header=header, fmt=outfmt, )
def _get_detstat_from_loglikelihood(self, idx=None): """Inverts the extra terms applied in logl().""" return ( self.lnlikes[idx if idx is not None else ...] - self.likelihoodcoef ) / self.likelihooddetstatmultiplier
[docs] def get_max_twoF(self): """Get the max. likelihood (loudest) sample and the compute its corresponding detection statistic. The employed detection statistic depends on `self.BSGL` (i.e. 2F if `self.BSGL` evaluates to `False`, log10BSGL otherwise). Returns ------- d: dict Parameters of the loudest sample. maxtwoF: float Detection statistic (2F or log10BSGL) corresponding to the loudest sample. """ if not hasattr(self, "search"): raise RuntimeError( "Object has no self.lnlikes attribute, please execute .run() first." ) if any(np.isposinf(self.lnlikes)): logging.info("lnlike values contain positive infinite values") if any(np.isneginf(self.lnlikes)): logging.info("lnlike values contain negative infinite values") if any(np.isnan(self.lnlikes)): logging.info("lnlike values contain nan") idxs = np.isfinite(self.lnlikes) jmax = np.nanargmax(self.lnlikes[idxs]) d = OrderedDict() if self.BSGL: # need to recompute twoF at the max likelihood if hasattr(self, "search") is False: self._initiate_search_object() p = self._set_point_for_evaluation(self.samples[jmax]) self.search.BSGL = False if isinstance(p, dict): maxtwoF = self.search.get_det_stat(**p) else: maxtwoF = self.search.get_det_stat(*p) self.search.BSGL = self.BSGL else: # can just reuse the logl value maxtwoF = self._get_detstat_from_loglikelihood(jmax) repeats = [] for i, k in enumerate(self.theta_keys): if k in d and k not in repeats: d[k + "_0"] = d[k] # relabel the old key d.pop(k) repeats.append(k) if k in repeats: k = k + "_0" count = 1 while k in d: k = k.replace("_{}".format(count - 1), "_{}".format(count)) count += 1 d[k] = self.samples[jmax][i] return d, maxtwoF
[docs] def get_summary_stats(self): """Returns a dict of point estimates for all production samples. Point estimates are computed on the MCMC samples using `numpy.mean`, `numpy.std` and `numpy.quantiles` with q=[0.005, 0.05, 0.25, 0.5, 0.75, 0.95, 0.995]. Returns ------- d: dict Dictionary containing point estimates corresponding to ["mean", "std", "lower99", "lower90", "lower50", "median", "upper50", "upper90", "upper99"]. """ d = OrderedDict() repeats = [] # taken from old get_median_stds(), not sure why necessary for s, k in zip(self.samples.T, self.theta_keys): if k in d and k not in repeats: d[k + "_0"] = d[k] # relabel the old key d.pop(k) repeats.append(k) if k in repeats: k = k + "_0" count = 1 while k in d: k = k.replace("_{}".format(count - 1), "_{}".format(count)) count += 1 d[k] = {} d[k]["mean"] = np.mean(s) d[k]["std"] = np.std(s) ( d[k]["lower99"], d[k]["lower90"], d[k]["lower50"], d[k]["median"], d[k]["upper50"], d[k]["upper90"], d[k]["upper99"], ) = np.quantile(s, [0.005, 0.05, 0.25, 0.5, 0.75, 0.95, 0.995]) return d
[docs] def check_if_samples_are_railing(self, threshold=0.01): """Returns a boolean estimate of if the samples are railing Parameters ---------- threshold: float [0, 1] Fraction of the uniform prior to test (at upper and lower bound) Returns ------- return_flag: bool IF true, the samples are railing """ return_flag = False for s, k in zip(self.samples.T, self.theta_keys): prior = self.theta_prior[k] if prior["type"] == "unif": prior_range = prior["upper"] - prior["lower"] edges = [] fracs = [] for bound in ["lower", "upper"]: bools = np.abs(s - prior[bound]) / prior_range < threshold if np.any(bools): edges.append(bound) fracs.append(str(100 * float(np.sum(bools)) / len(bools))) if len(edges) > 0: logging.warning( "{}% of the {} posterior is railing on the {} edges".format( "% & ".join(fracs), k, " & ".join(edges) ) ) return_flag = True return return_flag
[docs] def write_par(self, method="median"): """Writes a .par of the best-fit params with an estimated std Parameters ---------- method: str How to select the `best-fit` params. Available methods: "median", "mean", "twoFmax". """ if method == "med": method = "median" if method in ["median", "mean"]: summary_stats = self.get_summary_stats() filename = os.path.join(self.outdir, self.label + "_" + method + ".par") logging.info("Writing {} using {} parameters.".format(filename, method)) elif method == "twoFmax": max_twoF_d, max_twoF = self.get_max_twoF() filename = os.path.join(self.outdir, self.label + "_max2F.par") logging.info("Writing {} at max twoF = {}.".format(filename, max_twoF)) else: raise ValueError("Method '{}' not supported.".format(method)) with open(filename, "w+") as f: for hline in self.output_file_header: f.write("# {:s}\n".format(hline)) if method == "twoFmax": f.write("MaxtwoF = {}\n".format(max_twoF)) f.write("tref = {}\n".format(self.tref)) if hasattr(self, "theta0_index"): f.write("theta0_index = {}\n".format(self.theta0_idx)) if method in ["median", "mean"]: for key, stat_d in summary_stats.items(): f.write( "{} = {:1.16e}\n".format( key, stat_d[method], ) ) elif method == "twoFmax": for key, val in max_twoF_d.items(): f.write("{} = {:1.16e}\n".format(key, val))
[docs] def generate_loudest(self): """Use lalapps_ComputeFstatistic_v2 to produce a .loudest file""" max_params, max_twoF = self.get_max_twoF() for key in self.theta_prior: if key not in max_params: max_params[key] = self.theta_prior[key] max_params = self.translate_keys_to_lal(max_params) for key in ["transient-t0Epoch", "transient-t0Offset", "transient-tau"]: if key in max_params and not int(max_params[key]) == max_params[key]: rounded = int(round(max_params[key])) logging.warning( "Rounding {:s}={:f} to {:d} for CFSv2 call.".format( key, max_params[key], rounded ) ) max_params[key] = rounded signal_parameter_keys = list( self.translate_keys_to_lal(self.theta_prior).keys() ) par_keys = list(max_params.keys()) pardiff = np.setdiff1d(par_keys, signal_parameter_keys) if len(pardiff) > 0: raise RuntimeError( f"Dictionary for parameters at max2F point {par_keys}" " did include keys" # " (other than refTime)" " not expected from signal parameters being searched over:" f" {pardiff} not in {signal_parameter_keys}." ) self.loudest_file = helper_functions.generate_loudest_file( max_params=max_params, tref=self.tref, outdir=self.outdir, label=self.label, sftfilepattern=self.sftfilepattern, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, transientWindowType=getattr(self, "transientWindowType", None), earth_ephem=self.earth_ephem, sun_ephem=self.sun_ephem, )
[docs] def write_prior_table(self): """Generate a .tex file of the prior""" with open(os.path.join(self.outdir, self.label + "_prior.tex"), "w") as f: f.write( r"\begin{tabular}{c l c} \hline" + "\n" r"Parameter & & & \\ \hhline{====}" ) for key, prior in self.theta_prior.items(): if type(prior) is dict: Type = prior["type"] if Type == "unif": a = prior["lower"] b = prior["upper"] line = r"{} & $\mathrm{{Unif}}$({}, {}) & {}\\" elif Type == "norm": a = prior["loc"] b = prior["scale"] line = r"{} & $\mathcal{{N}}$({}, {}) & {}\\" elif Type == "halfnorm": a = prior["loc"] b = prior["scale"] line = r"{} & $|\mathcal{{N}}$({}, {})| & {}\\" u = self.unit_dictionary[key] s = self.symbol_dictionary[key] f.write("\n") a = helper_functions.texify_float(a) b = helper_functions.texify_float(b) f.write(" " + line.format(s, a, b, u) + r" \\") f.write("\n\\end{tabular}\n")
[docs] def print_summary(self): """Prints a summary of the max twoF found to the terminal""" max_twoFd, max_twoF = self.get_max_twoF() summary_stats = self.get_summary_stats() logging.info("Summary:") if hasattr(self, "theta0_idx"): logging.info("theta0 index: {}".format(self.theta0_idx)) logging.info("Max twoF: {} with parameters:".format(max_twoF)) for k in np.sort(list(max_twoFd.keys())): logging.info(" {:10s} = {:1.9e}".format(k, max_twoFd[k])) logging.info("Mean +- std for production values:") for k in np.sort(list(summary_stats.keys())): logging.info( " {:10s} = {:1.9e} +/- {:1.9e}".format( k, summary_stats[k]["mean"], summary_stats[k]["std"] ) ) logging.info("Median and 90% quantiles for production values:") for k in np.sort(list(summary_stats.keys())): logging.info( " {:10s} = {:1.9e} - {:1.9e} + {:1.9e}".format( k, summary_stats[k]["median"], summary_stats[k]["median"] - summary_stats[k]["lower90"], summary_stats[k]["upper90"] - summary_stats[k]["median"], ) ) logging.info("\n")
def _CF_twoFmax(self, theta, twoFmax, ntrials): Fmax = twoFmax / 2.0 return ( np.exp(1j * theta * twoFmax) * ntrials / 2.0 * Fmax * np.exp(-Fmax) * (1 - (1 + Fmax) * np.exp(-Fmax)) ** (ntrials - 1) ) def _pdf_twoFhat(self, twoFhat, nglitch, ntrials, twoFmax=100, dtwoF=0.1): if np.ndim(ntrials) == 0: ntrials = np.zeros(nglitch + 1) + ntrials twoFmax_int = np.arange(0, twoFmax, dtwoF) theta_int = np.arange(-1 / dtwoF, 1.0 / dtwoF, 1.0 / twoFmax) CF_twoFmax_theta = np.array( [ [ np.trapz(self._CF_twoFmax(t, twoFmax_int, ntrial), twoFmax_int) for t in theta_int ] for ntrial in ntrials ] ) CF_twoFhat_theta = np.prod(CF_twoFmax_theta, axis=0) pdf = (1 / (2 * np.pi)) * np.array( [ np.trapz( np.exp(-1j * theta_int * twoFhat_val) * CF_twoFhat_theta, theta_int ) for twoFhat_val in twoFhat ] ) return pdf.real def _p_val_twoFhat(self, twoFhat, ntrials, twoFhatmax=500, Npoints=1000): """Caluculate the p-value for the given twoFhat in Gaussian noise Parameters ---------- twoFhat: float The observed twoFhat value ntrials: int, array of len Nglitch+1 The number of trials for each glitch+1 """ twoFhats = np.linspace(twoFhat, twoFhatmax, Npoints) pdf = self._pdf_twoFhat(twoFhats, self.nglitch, ntrials) return np.trapz(pdf, twoFhats)
[docs] def get_p_value(self, delta_F0=0, time_trials=0): """Gets the p-value for the maximum twoFhat value assuming Gaussian noise Parameters ---------- delta_F0: float Frequency variation due to a glitch. time_trials: int, optional Number of trials in each glitch + 1. """ d, max_twoF = self.get_max_twoF() if self.nglitch == 1: tglitches = [d["tglitch"]] else: tglitches = [d["tglitch_{}".format(i)] for i in range(self.nglitch)] tboundaries = [self.minStartTime] + tglitches + [self.maxStartTime] deltaTs = np.diff(tboundaries) ntrials = [time_trials + delta_F0 * dT for dT in deltaTs] p_val = self._p_val_twoFhat(max_twoF, ntrials) logging.info("p-value = {}".format(p_val)) return p_val
[docs] def compute_evidence(self, make_plots=False, write_to_file=None): """Computes the evidence/marginal likelihood for the model. Parameters ---------- make_plots: bool Plot the results and save them to os.path.join(self.outdir, self.label + "_beta_lnl.png") write_to_file: str If given, dump evidence and uncertainty estimation to the specified path. Returns ------- log10evidence: float Estimation of the log10 evidence. log10evidence_err: float Log10 uncertainty of the evidence estimation. """ betas = self.betas mean_lnlikes = np.mean(np.mean(self.all_lnlikelihood, axis=1), axis=1) mean_lnlikes = mean_lnlikes[::-1] betas = betas[::-1] if any(np.isinf(mean_lnlikes)): logging.warning( "mean_lnlikes contains inf: recalculating without" " the {} infs".format(len(betas[np.isinf(mean_lnlikes)])) ) idxs = np.isinf(mean_lnlikes) mean_lnlikes = mean_lnlikes[~idxs] betas = betas[~idxs] log10evidence = np.trapz(mean_lnlikes, betas) / np.log(10) z1 = np.trapz(mean_lnlikes, betas) z2 = np.trapz(mean_lnlikes[::-1][::2][::-1], betas[::-1][::2][::-1]) log10evidence_err = np.abs(z1 - z2) / np.log(10) logging.info( "log10 evidence for {} = {} +/- {}".format( self.label, log10evidence, log10evidence_err ) ) if write_to_file: EvidenceDict = self.read_evidence_file_to_dict(write_to_file) EvidenceDict[self.label] = [log10evidence, log10evidence_err] self.write_evidence_file_from_dict(EvidenceDict, write_to_file) if make_plots: fig, (ax1, ax2) = plt.subplots(nrows=2, figsize=(6, 8)) ax1.semilogx(betas, mean_lnlikes, "-o") ax1.set_xlabel(r"$\beta$") ax1.set_ylabel(r"$\langle \log(\mathcal{L}) \rangle$") min_betas = [] evidence = [] for i in range(int(len(betas) / 2.0)): min_betas.append(betas[i]) lnZ = np.trapz(mean_lnlikes[i:], betas[i:]) evidence.append(lnZ / np.log(10)) ax2.semilogx(min_betas, evidence, "-o") ax2.set_ylabel( r"$\int_{\beta_{\mathrm{Min}}}^{\beta=1}" + r"\langle \log(\mathcal{L})\rangle d\beta$", size=16, ) ax2.set_xlabel(r"$\beta_{\mathrm{min}}$") plt.tight_layout() fig.savefig(os.path.join(self.outdir, self.label + "_beta_lnl.png")) plt.close(fig) return log10evidence, log10evidence_err
[docs] @staticmethod def read_evidence_file_to_dict(evidence_file_name="Evidences.txt"): """Read evidence file and put it into an OrderedDict An evidence file contains paris (log10evidence, log10evidence_err) for each considered model. These pairs are prepended by the `self.label` variable. Parameters ---------- evidence_file_name: str Filename to read. Returns ------- EvidenceDict: dict Dictionary with the contents of `evidence_file_name` """ EvidenceDict = OrderedDict() if os.path.isfile(evidence_file_name): with open(evidence_file_name, "r") as f: for line in f: key, log10evidence, log10evidence_err = line.split(" ") EvidenceDict[key] = [float(log10evidence), float(log10evidence_err)] return EvidenceDict
[docs] def write_evidence_file_from_dict(self, EvidenceDict, evidence_file_name): """Write evidence dict to a file Parameters ---------- EvidenceDict: dict Dictionary to dump into a file. evidence_file_name: str File name to dump dict into. """ with open(evidence_file_name, "w+") as f: for key, val in EvidenceDict.items(): f.write("{} {} {}\n".format(key, val[0], val[1]))
[docs]class MCMCGlitchSearch(MCMCSearch): """MCMC search using the SemiCoherentGlitchSearch See parent MCMCSearch for a list of all additional parameters, here we list only the additional init parameters of this class. """ symbol_dictionary = dict( F0=r"$f$", F1=r"$\dot{f}$", F2=r"$\ddot{f}$", Alpha=r"$\alpha$", Delta=r"$\delta$", ) """ Key, val pairs of the parameters (`F0`, `F1`, ...), to LaTeX math symbols for plots """ glitch_symbol_dictionary = dict( delta_F0=r"$\delta f$", delta_F1=r"$\delta \dot{f}$", tglitch=r"$t_\mathrm{glitch}$", ) """ Key, val pairs of glitch parameters (`dF0`, `dF1`, `tglitch`), to LaTeX math symbols for plots. This dictionary included within `self.symbol_dictionary`. """ symbol_dictionary.update(glitch_symbol_dictionary) unit_dictionary = dict( F0=r"Hz", F1=r"Hz/s", F2=r"Hz/s$^2$", Alpha=r"rad", Delta=r"rad", delta_F0=r"Hz", delta_F1=r"Hz/s", tglitch=r"s", ) """ Key, val pairs of the parameters (`F0`, `F1`, ..., including glitch parameters), and the units (`Hz`, `Hz/s`, ...). """ transform_dictionary = dict( tglitch={ "multiplier": 1 / 86400.0, "subtractor": "minStartTime", "unit": "day", "label": r"$t^{g}_0$ \n [d]", } ) """ Key, val pairs of the parameters (`F0`, `F1`, ...), where the key is itself a dictionary which can item `multiplier`, `subtractor`, or `unit` by which to transform by and update the units. """ @helper_functions.initializer def __init__( self, theta_prior, tref, label, outdir="data", minStartTime=None, maxStartTime=None, sftfilepattern=None, detectors=None, nsteps=[100, 100], nwalkers=100, ntemps=1, log10beta_min=-5, theta_initial=None, rhohatmax=1000, binary=False, BSGL=False, SSBprec=None, RngMedWindow=None, minCoverFreq=None, maxCoverFreq=None, injectSources=None, assumeSqrtSX=None, dtglitchmin=1 * 86400, theta0_idx=0, nglitch=1, earth_ephem=None, sun_ephem=None, allowedMismatchFromSFTLength=None, ): """ Parameters ---------- nglitch: int The number of glitches to allow dtglitchmin: int The minimum duration (in seconds) of a segment between two glitches or a glitch and the start/end of the data theta0_idx, int Index (zero-based) of which segment the theta refers to - useful if providing a tight prior on theta to allow the signal to jump too theta (and not just from) """ self._set_init_params_dict(locals()) os.makedirs(outdir, exist_ok=True) self.output_file_header = self.get_output_file_header() self._add_log_file(self.output_file_header) logging.info( ( "Set-up MCMC glitch search with {} glitches for model {}" " on data {}" ).format(self.nglitch, self.label, self.sftfilepattern) ) self.pickle_path = os.path.join(self.outdir, self.label + "_saved_data.p") self._unpack_input_theta() self.ndim = len(self.theta_keys) if self.log10beta_min: self.betas = np.logspace(0, self.log10beta_min, self.ntemps) else: self.betas = None if args.clean and os.path.isfile(self.pickle_path): os.rename(self.pickle_path, self.pickle_path + ".old") self.old_data_is_okay_to_use = self._check_old_data_is_okay_to_use() self._log_input() self._set_likelihoodcoef() self.set_ephemeris_files(earth_ephem, sun_ephem) self.allowedMismatchFromSFTLength = allowedMismatchFromSFTLength def _set_likelihoodcoef(self): """Additional constant terms to turn a detection statistic into a likelihood. See MCMCSearch._set_likelihoodcoef for the base implementation. This method simply extends it in order to account for the increased number of segments due to the presence of glitches. """ super()._set_likelihoodcoef() self.likelihoodcoef *= self.nglitch + 1 def _initiate_search_object(self): logging.info("Setting up search object") search_ranges = self._get_search_ranges() self.search = core.SemiCoherentGlitchSearch( label=self.label, outdir=self.outdir, sftfilepattern=self.sftfilepattern, tref=self.tref, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq, search_ranges=search_ranges, detectors=self.detectors, BSGL=self.BSGL, nglitch=self.nglitch, theta0_idx=self.theta0_idx, injectSources=self.injectSources, earth_ephem=self.earth_ephem, sun_ephem=self.sun_ephem, allowedMismatchFromSFTLength=self.allowedMismatchFromSFTLength, ) if self.minStartTime is None: self.minStartTime = self.search.minStartTime if self.maxStartTime is None: self.maxStartTime = self.search.maxStartTime def _logp(self, theta_vals, theta_prior, theta_keys, search): if self.nglitch > 1: ts = ( [self.minStartTime] + list(theta_vals[-self.nglitch :]) + [self.maxStartTime] ) if np.array_equal(ts, np.sort(ts)) is False: return -np.inf if any(np.diff(ts) < self.dtglitchmin): return -np.inf H = [ self._generic_lnprior(**theta_prior[key])(p) for p, key in zip(theta_vals, theta_keys) ] return np.sum(H) def _logl(self, theta, search): in_theta = self._set_point_for_evaluation(theta) if self.nglitch > 1: ts = ( [self.minStartTime] + list(theta[-self.nglitch :]) + [self.maxStartTime] ) if np.array_equal(ts, np.sort(ts)) is False: return -np.inf # FIXME: BSGL case? twoF = search.get_semicoherent_nglitch_twoF(*in_theta) return twoF * self.likelihooddetstatmultiplier + self.likelihoodcoef def _unpack_input_theta(self): base_keys = ["F0", "F1", "F2", "Alpha", "Delta"] glitch_keys = ["delta_F0", "delta_F1", "tglitch"] full_glitch_keys = list( np.array([[gk] * self.nglitch for gk in glitch_keys]).flatten() ) if "tglitch_0" in self.theta_prior: full_glitch_keys[-self.nglitch :] = [ "tglitch_{}".format(i) for i in range(self.nglitch) ] full_glitch_keys[-2 * self.nglitch : -1 * self.nglitch] = [ "delta_F1_{}".format(i) for i in range(self.nglitch) ] full_glitch_keys[-4 * self.nglitch : -2 * self.nglitch] = [ "delta_F0_{}".format(i) for i in range(self.nglitch) ] full_theta_keys = base_keys + full_glitch_keys full_theta_keys_copy = copy.copy(full_theta_keys) full_glitch_symbols = list( np.array( [[gs] * self.nglitch for gs in self.glitch_symbol_dictionary] ).flatten() ) full_theta_symbols = [ self.symbol_dictionary[key] for key in base_keys ] + full_glitch_symbols self.theta_keys = [] fixed_theta_dict = {} for key, val in self.theta_prior.items(): if type(val) is dict: fixed_theta_dict[key] = 0 if key in glitch_keys: for i in range(self.nglitch): self.theta_keys.append(key) else: self.theta_keys.append(key) elif type(val) in [float, int, np.float64]: fixed_theta_dict[key] = val else: raise ValueError( "Type {} of {} in theta not recognised".format(type(val), key) ) if key in glitch_keys: for i in range(self.nglitch): full_theta_keys_copy.pop(full_theta_keys_copy.index(key)) else: full_theta_keys_copy.pop(full_theta_keys_copy.index(key)) if len(full_theta_keys_copy) > 0: raise ValueError( ("Input dictionary `theta` is missing the" "following keys: {}").format( full_theta_keys_copy ) ) self.fixed_theta = [fixed_theta_dict[key] for key in full_theta_keys] self.theta_idxs = [full_theta_keys.index(k) for k in self.theta_keys] self.theta_symbols = [full_theta_symbols[i] for i in self.theta_idxs] idxs = np.argsort(self.theta_idxs) self.theta_idxs = [self.theta_idxs[i] for i in idxs] self.theta_symbols = [self.theta_symbols[i] for i in idxs] self.theta_keys = [self.theta_keys[i] for i in idxs] # Correct for number of glitches in the idxs self.theta_idxs = np.array(self.theta_idxs) while np.sum(self.theta_idxs[:-1] == self.theta_idxs[1:]) > 0: for i, idx in enumerate(self.theta_idxs): if idx in self.theta_idxs[:i]: self.theta_idxs[i] += 1 self.output_keys = self.theta_keys.copy() self.output_keys.append("twoF") if self.BSGL: self.output_keys.append("log10BSGL") def _get_data_dictionary_to_save(self): d = dict( nsteps=self.nsteps, nwalkers=self.nwalkers, ntemps=self.ntemps, theta_keys=self.theta_keys, theta_prior=self.theta_prior, log10beta_min=self.log10beta_min, theta0_idx=self.theta0_idx, BSGL=self.BSGL, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, ) return d def _apply_corrections_to_p0(self, p0): p0 = np.array(p0) if self.nglitch > 1: p0[:, :, -self.nglitch :] = np.sort(p0[:, :, -self.nglitch :], axis=2) return p0
[docs] def plot_cumulative_max(self, savefig=True): """ Override MCMCSearch.plot_cumulative_max implementation to deal with the split at glitches. Parameters ---------- savefig: boolean included for consistency with core plot_twoF_cumulative() function. If true, save the figure in outdir. If false, return an axis object. """ logging.info("Getting cumulative 2F") fig, ax = plt.subplots() d, maxtwoF = self.get_max_twoF() for key, val in self.theta_prior.items(): if key not in d: d[key] = val if self.nglitch > 1: delta_F0s = [d["delta_F0_{}".format(i)] for i in range(self.nglitch)] delta_F0s.insert(self.theta0_idx, 0) delta_F0s = np.array(delta_F0s) delta_F0s[: self.theta0_idx] *= -1 tglitches = [d["tglitch_{}".format(i)] for i in range(self.nglitch)] elif self.nglitch == 1: delta_F0s = [d["delta_F0"]] delta_F0s.insert(self.theta0_idx, 0) delta_F0s = np.array(delta_F0s) delta_F0s[: self.theta0_idx] *= -1 tglitches = [d["tglitch"]] tboundaries = [self.minStartTime] + tglitches + [self.maxStartTime] for j in range(self.nglitch + 1): ts = tboundaries[j] te = tboundaries[j + 1] if (te - ts) / 86400 < 5: logging.info("Period too short to perform cumulative search") continue if j < self.theta0_idx: summed_deltaF0 = np.sum(delta_F0s[j : self.theta0_idx]) F0_j = d["F0"] - summed_deltaF0 actual_ts, taus, twoFs = self.search.calculate_twoF_cumulative( F0_j, F1=d["F1"], F2=d["F2"], Alpha=d["Alpha"], Delta=d["Delta"], tstart=ts, tend=te, ) elif j >= self.theta0_idx: summed_deltaF0 = np.sum(delta_F0s[self.theta0_idx : j + 1]) F0_j = d["F0"] + summed_deltaF0 actual_ts, taus, twoFs = self.search.calculate_twoF_cumulative( F0_j, F1=d["F1"], F2=d["F2"], Alpha=d["Alpha"], Delta=d["Delta"], tstart=ts, tend=te, ) ax.plot(actual_ts + taus, twoFs) ax.set_xlabel("GPS time") if savefig: fig.savefig(os.path.join(self.outdir, self.label + "_twoFcumulative.png")) plt.close(fig) return ax
def _get_savetxt_fmt_dict(self): fmt_dict = helper_functions.get_doppler_params_output_format(self.theta_keys) if "tglitch" in self.theta_keys: fmt_dict["tglitch"] = "%d" if "delta_F0" in self.theta_keys: fmt_dict["delta_F0"] = "%.16g" if "delta_F1" in self.theta_keys: fmt_dict["delta_F1"] = "%.16g" fmt_dict["twoF"] = "%.9g" if self.BSGL: fmt_dict["log10BSGL"] = "%.9g" return fmt_dict
[docs]class MCMCSemiCoherentSearch(MCMCSearch): """MCMC search for a signal using the semicoherent ComputeFstat. Evaluates the semicoherent F-statistic acros a parameter space region corresponding to an isolated/binary-modulated CW signal. See MCMCSearch for a list of additional parameters, here we list only the additional init parameters of this class. """ def __init__( self, theta_prior, tref, label, outdir="data", minStartTime=None, maxStartTime=None, sftfilepattern=None, detectors=None, nsteps=[100, 100], nwalkers=100, ntemps=1, log10beta_min=-5, theta_initial=None, rhohatmax=1000, binary=False, BSGL=False, SSBprec=None, RngMedWindow=None, minCoverFreq=None, maxCoverFreq=None, injectSources=None, assumeSqrtSX=None, nsegs=None, earth_ephem=None, sun_ephem=None, allowedMismatchFromSFTLength=None, ): """ Parameters ---------- nsegs: int The number of segments into which the input datastream will be devided. Coherence time is computed internally as (maxStartTime - minStarTime) / nsegs. """ self._set_init_params_dict(locals()) self.theta_prior = theta_prior self.tref = tref self.label = label self.outdir = outdir self.minStartTime = minStartTime self.maxStartTime = maxStartTime self.sftfilepattern = sftfilepattern self.detectors = detectors self.nsteps = nsteps self.nwalkers = nwalkers self.ntemps = ntemps self.log10beta_min = log10beta_min self.theta_initial = theta_initial self.rhohatmax = rhohatmax self.binary = binary self.BSGL = BSGL self.SSBprec = SSBprec self.RngMedWindow = RngMedWindow self.minCoverFreq = minCoverFreq self.maxCoverFreq = maxCoverFreq self.injectSources = injectSources self.assumeSqrtSX = assumeSqrtSX self.nsegs = nsegs self.set_ephemeris_files(earth_ephem, sun_ephem) self.allowedMismatchFromSFTLength = allowedMismatchFromSFTLength os.makedirs(outdir, exist_ok=True) self.output_file_header = self.get_output_file_header() self._add_log_file(self.output_file_header) logging.info( ("Set-up MCMC semi-coherent search for model {} on data" "{}").format( self.label, self.sftfilepattern ) ) self.pickle_path = os.path.join(self.outdir, self.label + "_saved_data.p") self._unpack_input_theta() self.ndim = len(self.theta_keys) if self.log10beta_min: self.betas = np.logspace(0, self.log10beta_min, self.ntemps) else: self.betas = None if args.clean and os.path.isfile(self.pickle_path): os.rename(self.pickle_path, self.pickle_path + ".old") self._log_input() if self.nsegs: self._set_likelihoodcoef() else: logging.info("Value `nsegs` not yet provided") def _set_likelihoodcoef(self): """Additional constant terms to turn a detection statistic into a likelihood. See MCMCSearch._set_likelihoodcoef for the base implementation. This method simply extends it in order to account for the increased number of segments a semicoherent search works with. """ super()._set_likelihoodcoef() self.likelihoodcoef *= self.nsegs def _get_data_dictionary_to_save(self): d = dict( nsteps=self.nsteps, nwalkers=self.nwalkers, ntemps=self.ntemps, theta_keys=self.theta_keys, theta_prior=self.theta_prior, log10beta_min=self.log10beta_min, BSGL=self.BSGL, nsegs=self.nsegs, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, ) return d def _initiate_search_object(self): logging.info("Setting up search object") search_ranges = self._get_search_ranges() self.search = core.SemiCoherentSearch( label=self.label, outdir=self.outdir, tref=self.tref, nsegs=self.nsegs, sftfilepattern=self.sftfilepattern, binary=self.binary, BSGL=self.BSGL, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq, search_ranges=search_ranges, detectors=self.detectors, injectSources=self.injectSources, assumeSqrtSX=self.assumeSqrtSX, earth_ephem=self.earth_ephem, sun_ephem=self.sun_ephem, allowedMismatchFromSFTLength=self.allowedMismatchFromSFTLength, ) if self.minStartTime is None: self.minStartTime = self.search.minStartTime if self.maxStartTime is None: self.maxStartTime = self.search.maxStartTime def _logp(self, theta_vals, theta_prior, theta_keys, search): H = [ self._generic_lnprior(**theta_prior[key])(p) for p, key in zip(theta_vals, theta_keys) ] return np.sum(H)
[docs]class MCMCFollowUpSearch(MCMCSemiCoherentSearch): """Hierarchical follow-up procedure Executes MCMC runs with increasing coherence times in order to follow up a parameter space region. The main idea is to use an MCMC run to identify an interesting parameter space region to then zoom-in said region using a finer "effective resolution" by increasing the coherence time. See Ashton & Prix (PRD 97, 103020, 2018): https://arxiv.org/abs/1802.05450 See MCMCSemiCoherentSearch for a list of additional parameters, here we list only the additional init parameters of this class. """ def __init__( self, theta_prior, tref, label, outdir="data", minStartTime=None, maxStartTime=None, sftfilepattern=None, detectors=None, nsteps=[100, 100], nwalkers=100, ntemps=1, log10beta_min=-5, theta_initial=None, rhohatmax=1000, binary=False, BSGL=False, SSBprec=None, RngMedWindow=None, minCoverFreq=None, maxCoverFreq=None, injectSources=None, assumeSqrtSX=None, earth_ephem=None, sun_ephem=None, allowedMismatchFromSFTLength=None, ): self._set_init_params_dict(locals()) self.theta_prior = theta_prior self.tref = tref self.label = label self.outdir = outdir self.minStartTime = minStartTime self.maxStartTime = maxStartTime self.sftfilepattern = sftfilepattern self.detectors = detectors self.nsteps = nsteps self.nwalkers = nwalkers self.ntemps = ntemps self.log10beta_min = log10beta_min self.theta_initial = theta_initial self.rhohatmax = rhohatmax self.binary = binary self.BSGL = BSGL self.SSBprec = SSBprec self.RngMedWindow = RngMedWindow self.minCoverFreq = minCoverFreq self.maxCoverFreq = maxCoverFreq self.injectSources = injectSources self.assumeSqrtSX = assumeSqrtSX self.nsegs = None self.set_ephemeris_files(earth_ephem, sun_ephem) self.allowedMismatchFromSFTLength = allowedMismatchFromSFTLength os.makedirs(outdir, exist_ok=True) self.output_file_header = self.get_output_file_header() self._add_log_file(self.output_file_header) logging.info( ("Set-up MCMC semi-coherent search for model {} on data" "{}").format( self.label, self.sftfilepattern ) ) self.pickle_path = os.path.join(self.outdir, self.label + "_saved_data.p") self._unpack_input_theta() self.ndim = len(self.theta_keys) if self.log10beta_min: self.betas = np.logspace(0, self.log10beta_min, self.ntemps) else: self.betas = None if args.clean and os.path.isfile(self.pickle_path): os.rename(self.pickle_path, self.pickle_path + ".old") self._log_input() if self.nsegs: self._set_likelihoodcoef() else: logging.info("Value `nsegs` not yet provided") def _get_data_dictionary_to_save(self): d = dict( nwalkers=self.nwalkers, ntemps=self.ntemps, theta_keys=self.theta_keys, theta_prior=self.theta_prior, log10beta_min=self.log10beta_min, BSGL=self.BSGL, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, run_setup=self.run_setup, ) return d
[docs] def run( self, run_setup=None, proposal_scale_factor=2, NstarMax=10, Nsegs0=None, save_pickle=True, export_samples=True, save_loudest=True, plot_walkers=True, walker_plot_args=None, log_table=True, gen_tex_table=True, window=50, ): """Run the follow-up with the given run_setup. See MCMCSearch.run's docstring for a description of the remainder arguments. Parameters ---------- run_setup, log_table, gen_tex_table: See `MCMCFollowUpSearch.init_run_setup`. NstarMax, Nsegs0: See `pyfstat.optimal_setup_functions.get_optimal_setup`. """ self.nsegs = 1 self._set_likelihoodcoef() self._initiate_search_object() run_setup = self.init_run_setup( run_setup, NstarMax=NstarMax, Nsegs0=Nsegs0, log_table=log_table, gen_tex_table=gen_tex_table, ) self.run_setup = run_setup self._estimate_run_time() walker_plot_args = walker_plot_args or {} self.old_data_is_okay_to_use = self._check_old_data_is_okay_to_use() if self.old_data_is_okay_to_use is True: logging.warning("Using saved data from {}".format(self.pickle_path)) d = self.get_saved_data_dictionary() self.samples = d["samples"] self.lnprobs = d["lnprobs"] self.lnlikes = d["lnlikes"] self.all_lnlikelihood = d["all_lnlikelihood"] self.chain = d["chain"] self.nsegs = run_setup[-1][1] return nsteps_total = 0 for j, ((nburn, nprod), nseg, reset_p0) in enumerate(run_setup): p0 = self._get_p0_per_stage(reset_p0) self.nsegs = nseg self._set_likelihoodcoef() self.search.nsegs = nseg self._update_search_object() self.search.init_semicoherent_parameters() self.sampler = PTSampler( ntemps=self.ntemps, nwalkers=self.nwalkers, dim=self.ndim, logl=self._logl, logp=self._logp, logpargs=(self.theta_prior, self.theta_keys, self.search), loglargs=(self.search,), betas=self.betas, a=proposal_scale_factor, ) Tcoh = (self.maxStartTime - self.minStartTime) / nseg / 86400.0 logging.info( ( "Running {}/{} with {} steps and {} nsegs " "(Tcoh={:1.2f} days)" ).format(j + 1, len(run_setup), (nburn, nprod), nseg, Tcoh) ) self._run_sampler(p0, nburn=nburn, nprod=nprod, window=window) logging.info( "Max detection statistic of run was {}".format( np.max(self.sampler.loglikelihood) ) ) if plot_walkers: try: walkers_fig, walkers_axes = self._plot_walkers( nprod=nprod, xoffset=nsteps_total, **walker_plot_args ) for ax in walkers_axes[: self.ndim]: ax.axvline(nsteps_total, color="k", ls="--", lw=0.25) except Exception as e: logging.warning("Failed to plot walkers due to Error {}".format(e)) nsteps_total += nburn + nprod if plot_walkers: nstep_list = np.array( [el[0][0] for el in run_setup] + [run_setup[-1][0][1]] ) mids = np.cumsum(nstep_list) - nstep_list / 2 mid_labels = ["{:1.0f}".format(i) for i in np.arange(0, len(mids) - 1)] mid_labels += ["Production"] for ax in walkers_axes[: self.ndim]: axy = ax.twiny() axy.tick_params(pad=-10, direction="in", axis="x", which="major") axy.minorticks_off() axy.set_xlim(ax.get_xlim()) axy.set_xticks(mids) axy.set_xticklabels(mid_labels) samples = self.sampler.chain[0, :, nburn:, :].reshape((-1, self.ndim)) lnprobs = self.sampler.logprobability[0, :, nburn:].reshape((-1)) lnlikes = self.sampler.loglikelihood[0, :, nburn:].reshape((-1)) all_lnlikelihood = self.sampler.loglikelihood self.samples = samples self.lnprobs = lnprobs self.lnlikes = lnlikes self.all_lnlikelihood = all_lnlikelihood if save_pickle: self._pickle_data(samples, lnprobs, lnlikes, all_lnlikelihood) if export_samples: self.export_samples_to_disk() if save_loudest: self.generate_loudest() if plot_walkers: try: walkers_fig.tight_layout() except Exception as e: logging.warning( "Failed to set tight layout for walkers plot due to Error {}".format( e ) ) if (walker_plot_args.get("fig") is not None) and ( walker_plot_args.get("axes") is not None ): self.walkers_fig = walkers_fig self.walkers_axes = walkers_axes else: try: walkers_fig.savefig( os.path.join(self.outdir, self.label + "_walkers.png") ) plt.close(walkers_fig) except Exception as e: logging.warning( "Failed to save walker plots due to Error {}".format(e) )
def _update_search_object(self): logging.info("Update search object") self.search.init_computefstatistic()
[docs] def init_run_setup( self, run_setup=None, NstarMax=1000, Nsegs0=None, log_table=True, gen_tex_table=True, ): """ Initialize the setup of the follow-up run computing the required quantities fro, NstarMax and Nsegs0. Parameters ---------- NstarMax, Nsegs0: int Required parameters to create a new follow-up setup. See `pyfstat.optimal_setup_functions.get_optimal_setup`. run_setup: optional If None, a new setup will be created from NstarMax and Nsegs0. Use `MCMCFollowUpSearch.read_setup_input_file` to read a previous setup file. log_table: bool Log follow-up setup using `logging.info` as a table. gen_tex_table: bool Dump follow-up setup into a text file as a tex table. File is constructed as `os.path.join(self.outdir, self.label + "_run_setup.tex")`. Returns ------- run_setup: list List containing the setup of the follow-up run. """ if run_setup is None and Nsegs0 is None: raise ValueError( "You must either specify the run_setup, or Nsegs0 and NStarMax" " from which the optimal run_setup can be estimated" ) if run_setup is None: logging.info("No run_setup provided") run_setup_input_file = os.path.join( self.outdir, self.label + "_run_setup.p" ) if os.path.isfile(run_setup_input_file): logging.info( "Checking old setup input file {}".format(run_setup_input_file) ) old_setup = self.read_setup_input_file(run_setup_input_file) if self._check_old_run_setup( old_setup, NstarMax=NstarMax, Nsegs0=Nsegs0, theta_prior=self.theta_prior, ): logging.info( "Using old setup with NstarMax={}, Nsegs0={}".format( NstarMax, Nsegs0 ) ) nsegs_vals = old_setup["nsegs_vals"] Nstar_vals = old_setup["Nstar_vals"] generate_setup = False else: generate_setup = True else: generate_setup = True if generate_setup: nsegs_vals, Nstar_vals = optimal_setup_functions.get_optimal_setup( NstarMax, Nsegs0, self.tref, self.minStartTime, self.maxStartTime, self.theta_prior, self.search.detector_names, ) self._write_setup_input_file( run_setup_input_file, NstarMax, Nsegs0, nsegs_vals, Nstar_vals, self.theta_prior, ) run_setup = [ ((self.nsteps[0], 0), nsegs, False) for nsegs in nsegs_vals[:-1] ] run_setup.append(((self.nsteps[0], self.nsteps[1]), nsegs_vals[-1], False)) else: logging.info("Calculating the number of templates for this setup") Nstar_vals = [] for i, rs in enumerate(run_setup): rs = list(rs) if len(rs) == 2: rs.append(False) if np.shape(rs[0]) == (): rs[0] = (rs[0], 0) run_setup[i] = rs if args.no_template_counting: Nstar_vals.append([1, 1, 1]) else: Nstar = optimal_setup_functions.get_Nstar_estimate( rs[1], self.tref, self.minStartTime, self.maxStartTime, self.theta_prior, self.search.detector_names, ) Nstar_vals.append(Nstar) if log_table: logging.info("Using run-setup as follows:") logging.info("Stage | nburn | nprod | nsegs | Tcoh d | resetp0 | Nstar") for i, rs in enumerate(run_setup): Tcoh = (self.maxStartTime - self.minStartTime) / rs[1] / 86400 if Nstar_vals[i] is None: vtext = "N/A" else: vtext = "{:0.3e}".format(int(Nstar_vals[i])) logging.info( "{} | {} | {} | {} | {} | {} | {}".format( str(i).ljust(5), str(rs[0][0]).ljust(5), str(rs[0][1]).ljust(5), str(rs[1]).ljust(5), "{:6.1f}".format(Tcoh), str(rs[2]).ljust(7), vtext, ) ) if gen_tex_table: filename = os.path.join(self.outdir, self.label + "_run_setup.tex") with open(filename, "w+") as f: f.write(r"\begin{tabular}{c|ccc}" + "\n") f.write( r"Stage & $N_\mathrm{seg}$ &" r"$T_\mathrm{coh}^{\rm days}$ &" r"$\mathcal{N}^*(\Nseg^{(\ell)}, \Delta\mathbf{\lambda}^{(0)})$ \\ \hline" "\n" ) for i, rs in enumerate(run_setup): Tcoh = float(self.maxStartTime - self.minStartTime) / rs[1] / 86400 line = r"{} & {} & {} & {} \\" + "\n" if Nstar_vals[i] is None: Nstar = "N/A" else: Nstar = Nstar_vals[i] line = line.format( i, rs[1], "{:1.1f}".format(Tcoh), helper_functions.texify_float(Nstar), ) f.write(line) f.write(r"\end{tabular}" + "\n") if args.setup_only: logging.info("Exit as requested by setup_only flag") sys.exit() else: return run_setup
[docs] def read_setup_input_file(self, run_setup_input_file): with open(run_setup_input_file, "rb+") as f: d = pickle.load(f) return d
def _write_setup_input_file( self, run_setup_input_file, NstarMax, Nsegs0, nsegs_vals, Nstar_vals, theta_prior, ): d = dict( NstarMax=NstarMax, Nsegs0=Nsegs0, nsegs_vals=nsegs_vals, theta_prior=theta_prior, Nstar_vals=Nstar_vals, ) with open(run_setup_input_file, "wb+") as f: pickle.dump(d, f) def _check_old_run_setup(self, old_setup, **kwargs): try: truths = [val == old_setup[key] for key, val in kwargs.items()] if all(truths): return True else: logging.info("Old setup doesn't match one of NstarMax, Nsegs0 or prior") except KeyError as e: logging.info("Error found when comparing with old setup: {}".format(e)) return False def _get_p0_per_stage(self, reset_p0=False): """Returns new initial positions for walkers at each stage of the ladder""" if not hasattr(self, "sampler"): # must be stage 0 p0 = self._generate_initial_p0() p0 = self._apply_corrections_to_p0(p0) elif reset_p0: p0 = self._get_new_p0(self.sampler) p0 = self._apply_corrections_to_p0(p0) # self._check_initial_points(p0) else: p0 = self.sampler.chain[:, :, -1, :] return p0
[docs]class MCMCTransientSearch(MCMCSearch): """MCMC search for a transient signal using ComputeFstat""" symbol_dictionary = dict( F0=r"$f$", F1=r"$\dot{f}$", F2=r"$\ddot{f}$", Alpha=r"$\alpha$", Delta=r"$\delta$", transient_tstart=r"$t_\mathrm{start}$", transient_duration=r"$\Delta T$", ) """ Key, val pairs of the parameters (`F0`, `F1`, ...), to LaTeX math symbols for plots """ unit_dictionary = dict( F0=r"Hz", F1=r"Hz/s", F2=r"Hz/s$^2$", Alpha=r"rad", Delta=r"rad", transient_tstart=r"s", transient_duration=r"s", ) """ Key, val pairs of the parameters (`F0`, `F1`, ..., including glitch parameters), and the units (`Hz`, `Hz/s`, ...). """ transform_dictionary = dict( transient_duration={ "multiplier": 1 / 86400.0, "unit": "day", "symbol": "Transient duration", }, transient_tstart={ "multiplier": 1 / 86400.0, "subtractor": "minStartTime", "unit": "day", "label": "Transient start-time \n days after minStartTime", }, ) """ Key, val pairs of the parameters (`F0`, `F1`, ...), where the key is itself a dictionary which can item `multiplier`, `subtractor`, or `unit` by which to transform by and update the units. """ def _initiate_search_object(self): logging.info("Setting up search object") if not self.transientWindowType: self.transientWindowType = "rect" search_ranges = self._get_search_ranges() self.search = core.ComputeFstat( tref=self.tref, sftfilepattern=self.sftfilepattern, minCoverFreq=self.minCoverFreq, maxCoverFreq=self.maxCoverFreq, search_ranges=search_ranges, detectors=self.detectors, transientWindowType=self.transientWindowType, minStartTime=self.minStartTime, maxStartTime=self.maxStartTime, BSGL=self.BSGL, binary=self.binary, injectSources=self.injectSources, tCWFstatMapVersion=self.tCWFstatMapVersion, earth_ephem=self.earth_ephem, sun_ephem=self.sun_ephem, allowedMismatchFromSFTLength=self.allowedMismatchFromSFTLength, ) if self.minStartTime is None: self.minStartTime = self.search.minStartTime if self.maxStartTime is None: self.maxStartTime = self.search.maxStartTime def _set_point_for_evaluation(self, theta): """Combines fixed and variable parameters to form a valid evaluation point. Parameters ---------- theta: list or np.ndarray The sampled (variable) parameters. Returns ------- p: dict The full parameter space point as a dictionary. (different from base MCMCSearch class!) """ p = { key: self.fixed_theta[k] for k, key in enumerate(self.full_theta_keys) if "transient" not in key } p.update( { key: theta[k] for k, key in enumerate(self.theta_keys) if "transient" not in key } ) # FIXME: this can be simplified when changing all theta lists to dicts if "transient_tstart" in self.theta_keys: p["tstart"] = theta[self.theta_keys.index("transient_tstart")] else: p["tstart"] = self.fixed_theta[ self.full_theta_keys.index("transient_tstart") ] if "transient_duration" in self.theta_keys: tau = theta[self.theta_keys.index("transient_duration")] else: tau = self.fixed_theta[self.full_theta_keys.index("transient_duration")] p["tend"] = p["tstart"] + tau return p def _logl(self, theta, search): in_theta = self._set_point_for_evaluation(theta) if in_theta["tend"] > self.maxStartTime: return -np.inf detstat = search.get_det_stat(**in_theta) return detstat * self.likelihooddetstatmultiplier + self.likelihoodcoef def _unpack_input_theta(self): self.full_theta_keys = ["F0", "F1", "F2", "Alpha", "Delta"] if self.binary: self.full_theta_keys += ["asini", "period", "ecc", "tp", "argp"] self.full_theta_keys += ["transient_tstart", "transient_duration"] full_theta_keys_copy = copy.copy(self.full_theta_keys) self.theta_keys = [] fixed_theta_dict = {} for key, val in self.theta_prior.items(): if type(val) is dict: fixed_theta_dict[key] = 0 self.theta_keys.append(key) elif type(val) in [float, int, np.float64]: fixed_theta_dict[key] = val else: raise ValueError( "Type {} of {} in theta not recognised".format(type(val), key) ) full_theta_keys_copy.pop(full_theta_keys_copy.index(key)) if len(full_theta_keys_copy) > 0: raise ValueError( ("Input dictionary `theta` is missing the" "following keys: {}").format( full_theta_keys_copy ) ) self.fixed_theta = [fixed_theta_dict[key] for key in self.full_theta_keys] self.theta_idxs = [self.full_theta_keys.index(k) for k in self.theta_keys] self.theta_symbols = [self.symbol_dictionary[k] for k in self.theta_keys] idxs = np.argsort(self.theta_idxs) self.theta_idxs = [self.theta_idxs[i] for i in idxs] self.theta_symbols = [self.theta_symbols[i] for i in idxs] self.theta_keys = [self.theta_keys[i] for i in idxs] self.output_keys = self.theta_keys.copy() self.output_keys.append("twoF") if self.BSGL: self.output_keys.append("log10BSGL") def _get_savetxt_fmt_dict(self): fmt_dict = helper_functions.get_doppler_params_output_format(self.theta_keys) if "transient_tstart" in self.theta_keys: fmt_dict["transient_tstart"] = "%d" if "transient_duration" in self.theta_keys: fmt_dict["transient_duration"] = "%d" fmt_dict["twoF"] = "%.9g" if self.BSGL: fmt_dict["log10BSGL"] = "%.9g" return fmt_dict